2-[6-amino-4-(trifluoromethyl)-3-pyridyl]-N-[2-(dimethylamino)ethyl]-7-methyl-4-morpholino-pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide

ID: ALA4646999

PubChem CID: 156020800

Max Phase: Preclinical

Molecular Formula: C22H27F3N8O2

Molecular Weight: 492.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(C(=O)NCCN(C)C)cc2c(N3CCOCC3)nc(-c3cnc(N)cc3C(F)(F)F)nn12

Standard InChI:  InChI=1S/C22H27F3N8O2/c1-13-14(21(34)27-4-5-31(2)3)10-17-20(32-6-8-35-9-7-32)29-19(30-33(13)17)15-12-28-18(26)11-16(15)22(23,24)25/h10-12H,4-9H2,1-3H3,(H2,26,28)(H,27,34)

Standard InChI Key:  ZAJQIEXPUWHQTA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   32.3808  -15.8221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0929  -15.4107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8012  -15.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8012  -16.6451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0955  -17.0557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3808  -16.6462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6736  -17.0551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5083  -17.0540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2196  -16.6451    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.5083  -17.8717    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   35.2196  -17.4628    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.5134  -15.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5137  -14.5902    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2234  -14.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9359  -14.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9382  -15.4108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.2299  -15.8240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7160  -15.6612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1964  -14.9986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7125  -14.3385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0142  -14.9986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4231  -14.2915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2408  -14.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6497  -13.5802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4674  -13.5802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.8722  -12.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8722  -14.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4231  -15.7058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.9266  -16.4476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2234  -13.3633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5163  -12.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5163  -12.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2235  -11.7279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.9306  -12.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9306  -12.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
 12  3  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 12 17  2  0
 16 18  1  0
 19 18  2  0
 20 19  1  0
 15 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 21 28  2  0
 18 29  1  0
 14 30  1  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 34 33  1  0
 35 34  1  0
 30 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4646999

    ---

Associated Targets(Human)

SJRH30 (203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.51Molecular Weight (Monoisotopic): 492.2209AlogP: 1.83#Rotatable Bonds: 6
Polar Surface Area: 113.91Molecular Species: BASEHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.51CX LogP: 2.48CX LogD: 1.34
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.54Np Likeness Score: -1.50

References

1. Xiang HY, Chen YH, Wang Y, Zhang X, Ding J, Meng LH, Yang CH..  (2020)  Design, synthesis and antiproliferative activity evaluation of a series of pyrrolo[2,1-f][1,2,4]triazine derivatives.,  30  (12): [PMID:32317209] [10.1016/j.bmcl.2020.127194]

Source