The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-methyl-N-(1-(2-([1,1'-biphenyl]-4-ylamino)benzoyl)piperidin-4-yl)-2-trifluoromethyl-4-fluoro-benzamide ID: ALA4647112
PubChem CID: 156021677
Max Phase: Preclinical
Molecular Formula: C33H29F4N3O2
Molecular Weight: 575.61
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C(=O)c1ccc(F)cc1C(F)(F)F)C1CCN(C(=O)c2ccccc2Nc2ccc(-c3ccccc3)cc2)CC1
Standard InChI: InChI=1S/C33H29F4N3O2/c1-39(31(41)27-16-13-24(34)21-29(27)33(35,36)37)26-17-19-40(20-18-26)32(42)28-9-5-6-10-30(28)38-25-14-11-23(12-15-25)22-7-3-2-4-8-22/h2-16,21,26,38H,17-20H2,1H3
Standard InChI Key: JUUPOXCCHOFKNI-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
40.3114 -13.2139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1375 -13.2151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5518 -12.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1371 -11.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.3078 -11.7878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9014 -12.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8998 -13.9315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5529 -13.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1363 -14.6460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.3808 -13.9336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.7884 -14.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6127 -14.6513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0331 -13.9402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6189 -13.2205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7884 -13.2162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8610 -13.9439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.2695 -14.6592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2761 -13.2283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8544 -15.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0975 -14.6629 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.0287 -15.3681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6095 -16.0828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0223 -16.8032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.8544 -16.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2657 -16.0890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0761 -13.9338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6650 -13.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8421 -13.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4314 -13.9376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8496 -14.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6712 -14.6467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6088 -17.5156 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
46.0894 -16.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5016 -16.8019 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
46.5010 -15.3752 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
46.9094 -16.0872 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
36.6080 -13.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1938 -13.2280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3709 -13.2310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9611 -13.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3803 -14.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2018 -14.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
2 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 0
16 17 1 0
16 18 1 0
17 19 1 0
17 20 2 0
19 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 19 1 0
7 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
23 32 1 0
25 33 1 0
33 34 1 0
33 35 1 0
33 36 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
29 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 575.61Molecular Weight (Monoisotopic): 575.2196AlogP: 7.63#Rotatable Bonds: 6Polar Surface Area: 52.65Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.79CX LogD: 7.79Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.24Np Likeness Score: -1.45
References 1. Ji D, Zhang W, Xu Y, Zhang JJ.. (2020) Design, synthesis and biological evaluation of anthranilamide derivatives as potent SMO inhibitors., 28 (6): [PMID:32063403 ] [10.1016/j.bmc.2020.115354 ]