The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(4-(6-((5-(3,4-Difluorostyryl)thiazol-2-yl)amino)-2-methylpyrimidin-4-yl)piperazin-1-yl)hex-5-yn-1-one ID: ALA4647144
PubChem CID: 156020260
Max Phase: Preclinical
Molecular Formula: C26H26F2N6OS
Molecular Weight: 508.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCCCC(=O)N1CCN(c2cc(Nc3ncc(/C=C/c4ccc(F)c(F)c4)s3)nc(C)n2)CC1
Standard InChI: InChI=1S/C26H26F2N6OS/c1-3-4-5-6-25(35)34-13-11-33(12-14-34)24-16-23(30-18(2)31-24)32-26-29-17-20(36-26)9-7-19-8-10-21(27)22(28)15-19/h1,7-10,15-17H,4-6,11-14H2,2H3,(H,29,30,31,32)/b9-7+
Standard InChI Key: PCXCLNAEWVNORT-VQHVLOKHSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
31.7560 -24.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7697 -23.6867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4892 -23.2907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4989 -22.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8037 -22.0512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0842 -22.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0640 -23.2678 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.3891 -22.0265 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.4089 -21.2120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7037 -20.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9845 -21.1751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.9746 -21.9957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6750 -22.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2894 -20.7545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5752 -21.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8743 -20.7238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1602 -21.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4633 -20.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7641 -20.2727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3060 -19.9397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.2130 -22.0787 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2303 -21.2639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5737 -20.7697 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.8453 -19.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6601 -20.0153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8971 -20.7938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3789 -19.3285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7269 -18.5891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2606 -17.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6128 -17.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1472 -16.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3319 -16.5786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9845 -17.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4522 -17.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1704 -17.3941 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.8647 -15.9081 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
3 4 1 0
5 4 2 0
6 5 1 0
7 6 2 0
2 7 1 0
6 8 1 0
9 8 1 0
10 9 1 0
11 10 1 0
11 12 1 0
13 12 1 0
8 13 1 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 3 0
14 20 2 0
21 4 1 0
22 21 1 0
23 22 1 0
23 24 1 0
25 24 2 0
26 25 1 0
22 26 2 0
27 24 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
33 35 1 0
32 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.60Molecular Weight (Monoisotopic): 508.1857AlogP: 4.89#Rotatable Bonds: 8Polar Surface Area: 74.25Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.83CX Basic pKa: 6.49CX LogP: 5.88CX LogD: 5.83Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -1.80
References 1. Yang Y, Gao H, Sun X, Sun Y, Qiu Y, Weng Q, Rao Y.. (2020) Global PROTAC Toolbox for Degrading BCR-ABL Overcomes Drug-Resistant Mutants and Adverse Effects., 63 (15): [PMID:32657579 ] [10.1021/acs.jmedchem.0c00967 ]