The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[1-[1-[3-chloro-6-(trifluoromethyl)benzothiophene-2-carbonyl]azetidin-3-yl]azetidin-3-yl]thiazole-2-carboxamide ID: ALA4647248
PubChem CID: 56925154
Max Phase: Preclinical
Molecular Formula: C20H16ClF3N4O2S2
Molecular Weight: 500.96
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC1CN(C2CN(C(=O)c3sc4cc(C(F)(F)F)ccc4c3Cl)C2)C1)c1nccs1
Standard InChI: InChI=1S/C20H16ClF3N4O2S2/c21-15-13-2-1-10(20(22,23)24)5-14(13)32-16(15)19(30)28-8-12(9-28)27-6-11(7-27)26-17(29)18-25-3-4-31-18/h1-5,11-12H,6-9H2,(H,26,29)
Standard InChI Key: OQJXRSOQCVCYFK-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
4.3831 -4.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3831 -5.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2044 -5.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2044 -4.9444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7864 -4.3624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6077 -4.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6077 -3.5411 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7864 -3.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1856 -2.9633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9790 -3.1748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9741 -2.1698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8011 -6.3477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 -7.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4348 -7.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8102 -7.3527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6228 -7.5957 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.2491 -8.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8311 -8.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5644 -8.5373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2748 -3.9395 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.6212 -2.6970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3064 -3.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0942 -3.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6735 -4.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4652 -4.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6743 -3.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0935 -2.8882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0448 -4.8348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8335 -4.6209 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.8357 -5.6248 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.6223 -5.4108 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.5779 -1.8809 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 5 1 0
7 9 1 0
9 10 1 0
9 11 2 0
2 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 14 2 0
10 20 1 0
20 23 1 0
22 21 1 0
21 10 2 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
21 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.96Molecular Weight (Monoisotopic): 500.0355AlogP: 3.97#Rotatable Bonds: 4Polar Surface Area: 65.54Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.25CX Basic pKa: 3.96CX LogP: 3.47CX LogD: 3.47Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.59Np Likeness Score: -1.85
References 1. Zhu B, Connolly PJ, Zhang SP, Chevalier KM, Milligan CM, Flores CM, Macielag MJ.. (2020) The discovery of diazetidinyl diamides as potent and reversible inhibitors of monoacylglycerol lipase (MAGL)., 30 (12): [PMID:32334914 ] [10.1016/j.bmcl.2020.127198 ]