N-(2-Aminoethyl)-2-carbamimidoyl-7-isopropoxy-benzothiophene-4-carboxamide

ID: ALA4647262

PubChem CID: 156021683

Max Phase: Preclinical

Molecular Formula: C15H20N4O2S

Molecular Weight: 320.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)Oc1ccc(C(=O)NCCN)c2cc(C(=N)N)sc12

Standard InChI:  InChI=1S/C15H20N4O2S/c1-8(2)21-11-4-3-9(15(20)19-6-5-16)10-7-12(14(17)18)22-13(10)11/h3-4,7-8H,5-6,16H2,1-2H3,(H3,17,18)(H,19,20)

Standard InChI Key:  QQSZVTLMNLKSAG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   11.5033  -11.5988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2164  -11.1886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9298  -11.5983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9298  -12.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2190  -12.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5033  -12.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2190  -13.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9364  -14.0732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5058  -14.0732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7926  -13.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0752  -14.0732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3621  -13.6585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7141  -12.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1990  -12.0132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7141  -11.3421    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.0244  -12.0132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4350  -11.2958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4350  -12.7263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.2164  -10.3632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5032   -9.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5032   -9.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7901  -10.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  4 13  1  0
 14 13  2  0
 15 14  1  0
  3 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
  2 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4647262

    ---

Associated Targets(Human)

SFN Tbio 14-3-3 protein sigma (29 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 320.42Molecular Weight (Monoisotopic): 320.1307AlogP: 1.66#Rotatable Bonds: 6
Polar Surface Area: 114.22Molecular Species: BASEHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.24CX LogP: 0.80CX LogD: -2.04
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.48Np Likeness Score: -0.86

References

1. Guillory X, Wolter M, Leysen S, Neves JF, Kuusk A, Genet S, Somsen B, Morrow JK, Rivers E, van Beek L, Patel J, Goodnow R, Schoenherr H, Fuller N, Cao Q, Doveston RG, Brunsveld L, Arkin MR, Castaldi P, Boyd H, Landrieu I, Chen H, Ottmann C..  (2020)  Fragment-based Differential Targeting of PPI Stabilizer Interfaces.,  63  (13): [PMID:32501690] [10.1021/acs.jmedchem.9b01942]

Source