(R)-5-Benzyl-1-(tert-butyl)-6-((1-(4-fluorophenyl)ethyl)amino)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one

ID: ALA4647278

PubChem CID: 156019974

Max Phase: Preclinical

Molecular Formula: C24H26FN5O

Molecular Weight: 419.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](Nc1nc2c(cnn2C(C)(C)C)c(=O)n1Cc1ccccc1)c1ccc(F)cc1

Standard InChI:  InChI=1S/C24H26FN5O/c1-16(18-10-12-19(25)13-11-18)27-23-28-21-20(14-26-30(21)24(2,3)4)22(31)29(23)15-17-8-6-5-7-9-17/h5-14,16H,15H2,1-4H3,(H,27,28)/t16-/m1/s1

Standard InChI Key:  XIMMQQRUYYGBED-MRXNPFEDSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   31.0409   -3.6732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.0409   -4.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7462   -4.8990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.7462   -3.2564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4556   -3.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4555   -4.4910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2335   -4.7426    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.7160   -4.0801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.2336   -3.4178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7462   -2.4351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3311   -3.2683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6255   -3.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9189   -3.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2138   -3.6854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2175   -4.5035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9323   -4.9082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6345   -4.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4852   -5.5163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3338   -4.9042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.3350   -5.7214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6278   -6.1310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9231   -5.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2164   -6.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2172   -6.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9304   -7.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6342   -6.9424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0433   -6.1289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9385   -6.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2845   -5.6860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6947   -6.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5106   -7.3568    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  4 10  2  0
  1 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  7 18  1  0
  2 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 20 27  1  6
 18 28  1  0
 18 29  1  0
 18 30  1  0
 24 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4647278

    ---

Associated Targets(Human)

PDE1C Tclin Phosphodiesterase 1C (228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.50Molecular Weight (Monoisotopic): 419.2121AlogP: 4.71#Rotatable Bonds: 5
Polar Surface Area: 64.74Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.43CX LogP: 4.58CX LogD: 4.58
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -1.72

References

1. Wu Y, Tian YJ, Le ML, Zhang SR, Zhang C, Huang MX, Jiang MY, Zhang B, Luo HB..  (2020)  Discovery of Novel Selective and Orally Bioavailable Phosphodiesterase-1 Inhibitors for the Efficient Treatment of Idiopathic Pulmonary Fibrosis.,  63  (14): [PMID:32603117] [10.1021/acs.jmedchem.0c00711]

Source