The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Amphiepicoccin A ID: ALA4647711
PubChem CID: 156020387
Max Phase: Preclinical
Molecular Formula: C18H14N2O5S2
Molecular Weight: 402.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C[C@H]2SS[C@@]34C[C@@H]1[C@@H]([C@H]2O)N3C(=O)c1cc2cc(O)ccc2n1C4=O
Standard InChI: InChI=1S/C18H14N2O5S2/c21-8-1-2-10-7(3-8)4-11-16(24)20-14-9-6-18(20,17(25)19(10)11)27-26-13(15(14)23)5-12(9)22/h1-4,9,13-15,21,23H,5-6H2/t9-,13+,14-,15-,18+/m0/s1
Standard InChI Key: UKMJCOXENYPZIK-KFWNZVQASA-N
Molfile:
RDKit 2D
30 35 0 0 0 0 0 0 0 0999 V2000
7.6349 -5.0765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3319 -4.6762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3319 -3.8672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6349 -3.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9379 -4.6762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9334 -3.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1704 -4.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6905 -4.2786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1618 -3.6270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8299 -2.8976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8914 -4.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5626 -3.4653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0253 -2.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5521 -2.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7942 -3.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7890 -2.4255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0962 -2.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4080 -2.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4171 -3.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1105 -3.6295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4187 -4.8605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3040 -2.2391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7047 -2.0390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4674 -4.0653 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.7551 -4.4409 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.9337 -5.4851 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.9255 -3.0583 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.6349 -5.8854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6360 -2.6497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0304 -3.4586 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 1 0
2 3 1 0
3 4 1 0
5 6 1 0
6 9 1 0
8 7 1 0
7 5 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 1 0
13 14 2 0
14 16 1 0
15 12 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
11 21 2 0
10 22 2 0
18 23 1 0
8 24 1 6
3 25 1 0
24 25 1 0
5 26 1 1
6 27 1 1
1 28 2 0
4 29 1 1
3 30 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.45Molecular Weight (Monoisotopic): 402.0344AlogP: 1.62#Rotatable Bonds: ┄Polar Surface Area: 99.84Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.55CX Basic pKa: ┄CX LogP: 0.95CX LogD: 0.95Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.65Np Likeness Score: 1.69
References 1. Wang Q, Zhang K, Wang W, Zhang G, Zhu T, Che Q, Gu Q, Li D.. (2020) Amphiepicoccins A-J: Epipolythiodioxopiperazines from the Fish-Gill-Derived Fungus Epicoccum nigrum HDN17-88., 83 (2): [PMID:31975590 ] [10.1021/acs.jnatprod.9b01242 ]