(S)-7-(6-Amino-4-fluoropyridin-3-yl)-N-(azepan-3-yl)isoquinolin-5-amine

ID: ALA4647780

PubChem CID: 156021285

Max Phase: Preclinical

Molecular Formula: C20H22FN5

Molecular Weight: 351.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1cc(F)c(-c2cc(N[C@H]3CCCCNC3)c3ccncc3c2)cn1

Standard InChI:  InChI=1S/C20H22FN5/c21-18-9-20(22)25-12-17(18)13-7-14-10-24-6-4-16(14)19(8-13)26-15-3-1-2-5-23-11-15/h4,6-10,12,15,23,26H,1-3,5,11H2,(H2,22,25)/t15-/m0/s1

Standard InChI Key:  TXJGOKZAFCPPSJ-HNNXBMFYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
    5.9490  -15.8631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2410  -16.2703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2410  -17.0944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9516  -17.4998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6573  -17.0892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6573  -16.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5316  -17.5061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8191  -17.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8165  -16.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5244  -15.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5244  -15.0428    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8163  -14.6310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7935  -13.8107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1390  -13.3207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3512  -13.5328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0125  -14.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3863  -14.9961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1927  -15.1552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1111  -17.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1107  -18.3235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4010  -18.7284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6927  -18.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6904  -17.5069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3986  -17.0896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9846  -18.7282    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8188  -18.7311    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  3  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  2 10  1  0
 10 11  1  0
 12 11  1  6
 13 12  1  0
 13 14  1  0
 14 15  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 12 18  1  0
 19  8  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
 22 25  1  0
 20 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4647780

    ---

Associated Targets(Human)

PRKCZ Tchem Protein kinase C zeta (2414 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 351.43Molecular Weight (Monoisotopic): 351.1859AlogP: 3.57#Rotatable Bonds: 3
Polar Surface Area: 75.86Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.84CX LogP: 2.10CX LogD: -0.30
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.67Np Likeness Score: -0.41

References

1. Atobe M, Serizawa T, Yamakawa N, Takaba K, Nagano Y, Yamaura T, Tanaka E, Tazumi A, Bito S, Ishiguro M, Kawanishi M..  (2020)  Discovery of 4,6- and 5,7-Disubstituted Isoquinoline Derivatives as a Novel Class of Protein Kinase C ζ Inhibitors with Fragment-Merging Strategy.,  63  (13): [PMID:32551607] [10.1021/acs.jmedchem.0c00449]

Source