The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[6-amino-4-(trifluoromethyl)-3-pyridyl]-N-(3-methoxypropyl)-4-morpholino-pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide ID: ALA4647790
PubChem CID: 156021291
Max Phase: Preclinical
Molecular Formula: C21H24F3N7O3
Molecular Weight: 479.46
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCCNC(=O)c1cc2c(N3CCOCC3)nc(-c3cnc(N)cc3C(F)(F)F)nn2c1
Standard InChI: InChI=1S/C21H24F3N7O3/c1-33-6-2-3-26-20(32)13-9-16-19(30-4-7-34-8-5-30)28-18(29-31(16)12-13)14-11-27-17(25)10-15(14)21(22,23)24/h9-12H,2-8H2,1H3,(H2,25,27)(H,26,32)
Standard InChI Key: NADXNWLOCVITTL-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
31.1754 -14.6161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.8876 -14.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5959 -14.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5959 -15.4391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8901 -15.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1754 -15.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4683 -15.8491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3030 -15.8480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0143 -15.4391 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.3030 -16.6658 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.0143 -16.2569 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.3081 -14.2038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3084 -13.3842 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0181 -12.9752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7306 -13.3871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7328 -14.2049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0246 -14.6181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5107 -14.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9911 -13.7927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5071 -13.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8088 -13.7927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2177 -13.0855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0355 -13.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4443 -12.3743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2621 -12.3743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6668 -11.6671 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4846 -11.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2177 -14.4998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0181 -12.1574 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3110 -11.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3110 -10.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0181 -10.5220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7253 -10.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7252 -11.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
4 8 1 0
8 9 1 0
8 10 1 0
8 11 1 0
12 3 1 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 1 0
17 16 1 0
12 17 2 0
16 18 1 0
19 18 2 0
20 19 1 0
15 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
21 28 2 0
14 29 1 0
30 29 1 0
31 30 1 0
32 31 1 0
33 32 1 0
34 33 1 0
29 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.46Molecular Weight (Monoisotopic): 479.1893AlogP: 2.00#Rotatable Bonds: 7Polar Surface Area: 119.90Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.11CX LogP: 2.28CX LogD: 2.27Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.49Np Likeness Score: -1.31
References 1. Xiang HY, Chen YH, Wang Y, Zhang X, Ding J, Meng LH, Yang CH.. (2020) Design, synthesis and antiproliferative activity evaluation of a series of pyrrolo[2,1-f][1,2,4]triazine derivatives., 30 (12): [PMID:32317209 ] [10.1016/j.bmcl.2020.127194 ]