2-[6-amino-4-(trifluoromethyl)-3-pyridyl]-N-(3-methoxypropyl)-4-morpholino-pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide

ID: ALA4647790

PubChem CID: 156021291

Max Phase: Preclinical

Molecular Formula: C21H24F3N7O3

Molecular Weight: 479.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCCNC(=O)c1cc2c(N3CCOCC3)nc(-c3cnc(N)cc3C(F)(F)F)nn2c1

Standard InChI:  InChI=1S/C21H24F3N7O3/c1-33-6-2-3-26-20(32)13-9-16-19(30-4-7-34-8-5-30)28-18(29-31(16)12-13)14-11-27-17(25)10-15(14)21(22,23)24/h9-12H,2-8H2,1H3,(H2,25,27)(H,26,32)

Standard InChI Key:  NADXNWLOCVITTL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   31.1754  -14.6161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.8876  -14.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5959  -14.6156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5959  -15.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8901  -15.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1754  -15.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4683  -15.8491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3030  -15.8480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0143  -15.4391    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.3030  -16.6658    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.0143  -16.2569    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   33.3081  -14.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3084  -13.3842    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0181  -12.9752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7306  -13.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7328  -14.2049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0246  -14.6181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.5107  -14.4553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9911  -13.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5071  -13.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8088  -13.7927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2177  -13.0855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0355  -13.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4443  -12.3743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2621  -12.3743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6668  -11.6671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.4846  -11.6671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2177  -14.4998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.0181  -12.1574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3110  -11.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3110  -10.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0181  -10.5220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.7253  -10.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7252  -11.7485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
 12  3  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 12 17  2  0
 16 18  1  0
 19 18  2  0
 20 19  1  0
 15 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 21 28  2  0
 14 29  1  0
 30 29  1  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 34 33  1  0
 29 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4647790

    ---

Associated Targets(Human)

SJRH30 (203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 479.46Molecular Weight (Monoisotopic): 479.1893AlogP: 2.00#Rotatable Bonds: 7
Polar Surface Area: 119.90Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.11CX LogP: 2.28CX LogD: 2.27
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.49Np Likeness Score: -1.31

References

1. Xiang HY, Chen YH, Wang Y, Zhang X, Ding J, Meng LH, Yang CH..  (2020)  Design, synthesis and antiproliferative activity evaluation of a series of pyrrolo[2,1-f][1,2,4]triazine derivatives.,  30  (12): [PMID:32317209] [10.1016/j.bmcl.2020.127194]

Source