rac-1-(([1,1'-biphenyl]-4-ylmethyl)amino)-3-(3-(phenylamino)phenoxy)propan-2-ol

ID: ALA4647987

PubChem CID: 156021169

Max Phase: Preclinical

Molecular Formula: C28H28N2O2

Molecular Weight: 424.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  OC(CNCc1ccc(-c2ccccc2)cc1)COc1cccc(Nc2ccccc2)c1

Standard InChI:  InChI=1S/C28H28N2O2/c31-27(20-29-19-22-14-16-24(17-15-22)23-8-3-1-4-9-23)21-32-28-13-7-12-26(18-28)30-25-10-5-2-6-11-25/h1-18,27,29-31H,19-21H2

Standard InChI Key:  OOXIDWAKDUZBSL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   26.3384  -12.6033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3384  -11.7783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.2073  -11.7659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.7687  -11.7783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0515  -11.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4901  -11.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7812  -12.6033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0556  -13.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0556  -13.0179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3425  -14.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6249  -13.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6337  -13.0179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9164  -11.3451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6372  -11.7452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6468  -12.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3628  -12.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0727  -12.5504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0581  -11.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3374  -11.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7920  -12.9516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8037  -13.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5244  -14.1767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2337  -13.7549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2181  -12.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4968  -12.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9132  -14.2519    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.1990  -13.8401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2032  -13.0154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4898  -12.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7730  -13.0128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7740  -13.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4880  -14.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 12  1  0
  2  1  1  0
  3  6  1  0
  4  5  1  0
  5  2  1  0
  6  4  1  0
  7  4  1  0
  8 10  2  0
  9  1  2  0
 10 11  1  0
  9  8  1  0
 11 12  2  0
  3 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  0
 11 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4647987

    ---

Associated Targets(Human)

SK-MEL-5 (47095 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SK-MEL-28 (48833 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A-375 (9258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TUBB4B Tclin Tubulin (5180 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.54Molecular Weight (Monoisotopic): 424.2151AlogP: 5.63#Rotatable Bonds: 10
Polar Surface Area: 53.52Molecular Species: BASEHBA: 4HBD: 3
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.61CX LogP: 5.63CX LogD: 4.40
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: -0.84

References

1. Chang Q, Long J, Hu L, Chen Z, Li Q, Hu G..  (2020)  Drug repurposing and rediscovery: Design, synthesis and preliminary biological evaluation of 1-arylamino-3-aryloxypropan-2-ols as anti-melanoma agents.,  28  (9): [PMID:32216987] [10.1016/j.bmc.2020.115404]

Source