The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-1-(([1,1'-biphenyl]-4-ylmethyl)amino)-3-(3-(phenylamino)phenoxy)propan-2-ol ID: ALA4647987
PubChem CID: 156021169
Max Phase: Preclinical
Molecular Formula: C28H28N2O2
Molecular Weight: 424.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: OC(CNCc1ccc(-c2ccccc2)cc1)COc1cccc(Nc2ccccc2)c1
Standard InChI: InChI=1S/C28H28N2O2/c31-27(20-29-19-22-14-16-24(17-15-22)23-8-3-1-4-9-23)21-32-28-13-7-12-26(18-28)30-25-10-5-2-6-11-25/h1-18,27,29-31H,19-21H2
Standard InChI Key: OOXIDWAKDUZBSL-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
26.3384 -12.6033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3384 -11.7783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.2073 -11.7659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.7687 -11.7783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0515 -11.3679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4901 -11.3679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7812 -12.6033 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0556 -13.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0556 -13.0179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3425 -14.2533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6249 -13.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6337 -13.0179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9164 -11.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6372 -11.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6468 -12.5712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3628 -12.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0727 -12.5504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0581 -11.7213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3374 -11.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7920 -12.9516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8037 -13.7776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5244 -14.1767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2337 -13.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2181 -12.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4968 -12.5263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9132 -14.2519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.1990 -13.8401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2032 -13.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4898 -12.5995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7730 -13.0128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7740 -13.8420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4880 -14.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 12 1 0
2 1 1 0
3 6 1 0
4 5 1 0
5 2 1 0
6 4 1 0
7 4 1 0
8 10 2 0
9 1 2 0
10 11 1 0
9 8 1 0
11 12 2 0
3 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 20 1 0
11 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.54Molecular Weight (Monoisotopic): 424.2151AlogP: 5.63#Rotatable Bonds: 10Polar Surface Area: 53.52Molecular Species: BASEHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.61CX LogP: 5.63CX LogD: 4.40Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.31Np Likeness Score: -0.84
References 1. Chang Q, Long J, Hu L, Chen Z, Li Q, Hu G.. (2020) Drug repurposing and rediscovery: Design, synthesis and preliminary biological evaluation of 1-arylamino-3-aryloxypropan-2-ols as anti-melanoma agents., 28 (9): [PMID:32216987 ] [10.1016/j.bmc.2020.115404 ]