The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R)-2-hydroxy-7-(2-methoxyethoxy)-3-(1,3,4-thiadiazol-2-ylsulfanyl)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid ID: ALA4648240
PubChem CID: 140786582
Max Phase: Preclinical
Molecular Formula: C14H15BN2O6S2
Molecular Weight: 382.23
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COCCOc1ccc2c(c1C(=O)O)OB(O)[C@@H](Sc1nncs1)C2
Standard InChI: InChI=1S/C14H15BN2O6S2/c1-21-4-5-22-9-3-2-8-6-10(25-14-17-16-7-24-14)15(20)23-12(8)11(9)13(18)19/h2-3,7,10,20H,4-6H2,1H3,(H,18,19)/t10-/m0/s1
Standard InChI Key: FWSDLSROJBQIQJ-JTQLQIEISA-N
Molfile:
RDKit 2D
25 27 0 0 0 0 0 0 0 0999 V2000
24.2307 -3.0197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9403 -2.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9375 -1.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2289 -1.3823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5226 -2.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5268 -1.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8230 -1.3801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1105 -1.7840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1064 -2.6036 0.0000 B 0 0 0 0 0 0 0 0 0 0 0 0
22.8147 -3.0192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.2305 -3.8369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5227 -4.2453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.9381 -4.2456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3963 -3.0079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.4055 -1.3709 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.6952 -1.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9538 -1.4345 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.4031 -2.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8072 -2.7487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.6075 -2.5838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6487 -3.0177 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3558 -2.6080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0641 -3.0155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0654 -3.8327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.3583 -4.2424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
1 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
8 15 1 1
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 2 0
2 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 382.23Molecular Weight (Monoisotopic): 382.0465AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. Hecker SJ, Reddy KR, Lomovskaya O, Griffith DC, Rubio-Aparicio D, Nelson K, Tsivkovski R, Sun D, Sabet M, Tarazi Z, Parkinson J, Totrov M, Boyer SH, Glinka TW, Pemberton OA, Chen Y, Dudley MN.. (2020) Discovery of Cyclic Boronic Acid QPX7728, an Ultrabroad-Spectrum Inhibitor of Serine and Metallo-β-lactamases., 63 (14): [PMID:32150407 ] [10.1021/acs.jmedchem.9b01976 ]