The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(4-(6-((5-(3-Hydroxystyryl)thiazol-2-yl)amino)-2-methylpyrimidin-4-yl)piperazin-1-yl)hex-5-yn-1-one ID: ALA4648248
PubChem CID: 156020517
Max Phase: Preclinical
Molecular Formula: C26H28N6O2S
Molecular Weight: 488.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCCCC(=O)N1CCN(c2cc(Nc3ncc(/C=C/c4cccc(O)c4)s3)nc(C)n2)CC1
Standard InChI: InChI=1S/C26H28N6O2S/c1-3-4-5-9-25(34)32-14-12-31(13-15-32)24-17-23(28-19(2)29-24)30-26-27-18-22(35-26)11-10-20-7-6-8-21(33)16-20/h1,6-8,10-11,16-18,33H,4-5,9,12-15H2,2H3,(H,27,28,29,30)/b11-10+
Standard InChI Key: SOXJZAJGTXZZPD-ZHACJKMWSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
8.2184 -24.5098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2321 -23.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9516 -23.2990 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9613 -22.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2661 -22.0594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5466 -22.4554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5265 -23.2761 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8515 -22.0348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8713 -21.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1662 -20.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4469 -21.1834 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4370 -22.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1374 -22.4278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7518 -20.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0376 -21.1558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3367 -20.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6226 -21.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9257 -20.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2265 -20.2810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7684 -19.9479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6754 -22.0870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6927 -21.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0361 -20.7779 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.3077 -20.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1225 -20.0236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3595 -20.8021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8413 -19.3367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1893 -18.5973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7230 -17.9263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0752 -17.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6096 -16.5189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7943 -16.5868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4469 -17.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9146 -17.9987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6328 -17.4023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
3 4 1 0
5 4 2 0
6 5 1 0
7 6 2 0
2 7 1 0
6 8 1 0
9 8 1 0
10 9 1 0
11 10 1 0
11 12 1 0
13 12 1 0
8 13 1 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 3 0
14 20 2 0
21 4 1 0
22 21 1 0
23 22 1 0
23 24 1 0
25 24 2 0
26 25 1 0
22 26 2 0
27 24 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.62Molecular Weight (Monoisotopic): 488.1994AlogP: 4.31#Rotatable Bonds: 8Polar Surface Area: 94.48Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.87CX Basic pKa: 6.48CX LogP: 5.31CX LogD: 5.24Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.32
References 1. Yang Y, Gao H, Sun X, Sun Y, Qiu Y, Weng Q, Rao Y.. (2020) Global PROTAC Toolbox for Degrading BCR-ABL Overcomes Drug-Resistant Mutants and Adverse Effects., 63 (15): [PMID:32657579 ] [10.1021/acs.jmedchem.0c00967 ]