The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-[[(2S)-2-[[(2S,4R)-1-[[5-(dimethylamino)-1-naphthyl]sulfonyl]-4-hydroxy-pyrrolidine-2-carbonyl]amino]-4-phenyl-butanoyl]amino]-5-guanidino-pentanoic acid ID: ALA4648299
PubChem CID: 156021035
Max Phase: Preclinical
Molecular Formula: C33H43N7O7S
Molecular Weight: 681.82
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1cccc2c(S(=O)(=O)N3C[C@H](O)C[C@H]3C(=O)N[C@@H](CCc3ccccc3)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)cccc12
Standard InChI: InChI=1S/C33H43N7O7S/c1-39(2)27-14-6-12-24-23(27)11-7-15-29(24)48(46,47)40-20-22(41)19-28(40)31(43)37-25(17-16-21-9-4-3-5-10-21)30(42)38-26(32(44)45)13-8-18-36-33(34)35/h3-7,9-12,14-15,22,25-26,28,41H,8,13,16-20H2,1-2H3,(H,37,43)(H,38,42)(H,44,45)(H4,34,35,36)/t22-,25+,26+,28+/m1/s1
Standard InChI Key: XQQSYSSWVQNXDX-NGXSIQFZSA-N
Molfile:
RDKit 2D
48 51 0 0 0 0 0 0 0 0999 V2000
15.8255 -10.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5376 -10.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2418 -10.7010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2418 -11.5163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5361 -11.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8255 -11.5216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5361 -12.7464 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.2441 -13.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8280 -13.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9543 -11.9303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6623 -11.5169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6597 -10.6992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9471 -10.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9471 -9.4722 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.2391 -9.0645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4924 -9.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9449 -8.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3523 -8.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1540 -8.2480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8181 -7.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7367 -6.9561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5262 -8.1772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2343 -7.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9465 -8.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6546 -7.7695 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.3626 -8.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0748 -7.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7829 -8.1772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0748 -6.9501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3626 -8.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0748 -9.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0748 -10.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7829 -10.6355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4910 -10.2279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1990 -10.6355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4910 -9.4084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9465 -8.9966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2343 -6.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5262 -6.5424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5262 -5.7229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8183 -5.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8193 -4.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5277 -4.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2360 -4.4940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2386 -5.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1255 -8.7866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7688 -9.4722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3589 -8.7641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
5 7 1 0
7 8 1 0
7 9 1 0
4 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
3 13 1 0
13 14 1 0
14 15 1 0
16 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
15 19 1 0
19 20 1 1
20 21 2 0
20 22 1 0
23 22 1 1
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
26 30 1 6
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
24 37 2 0
23 38 1 0
38 39 1 0
39 40 1 0
41 40 2 0
42 41 1 0
43 42 2 0
44 43 1 0
45 44 2 0
40 45 1 0
17 46 1 6
14 47 2 0
14 48 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 681.82Molecular Weight (Monoisotopic): 681.2945AlogP: 0.98#Rotatable Bonds: 15Polar Surface Area: 218.25Molecular Species: ZWITTERIONHBA: 8HBD: 7#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.64CX Basic pKa: 11.78CX LogP: -0.46CX LogD: -0.46Aromatic Rings: 3Heavy Atoms: 48QED Weighted: 0.07Np Likeness Score: -0.36
References 1. de la Sierra-Gallay IL, Belnou M, Chambraud B, Genet M, van Tilbeurgh H, Aumont-Nicaise M, Desmadril M, Baulieu EE, Jacquot Y, Byrne C.. (2020) Bioinspired Hybrid Fluorescent Ligands for the FK1 Domain of FKBP52., 63 (18): [PMID:32866001 ] [10.1021/acs.jmedchem.0c00825 ]