N-(5-(3,6-dioxocyclohexa-1,4-dienyl)-2-(pyrrolidin-1-ylmethyl)phenyl)-4-methoxybenzenesulfonamide

ID: ALA4648318

PubChem CID: 156021418

Max Phase: Preclinical

Molecular Formula: C24H24N2O5S

Molecular Weight: 452.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)Nc2cc(C3=CC(=O)C=CC3=O)ccc2CN2CCCC2)cc1

Standard InChI:  InChI=1S/C24H24N2O5S/c1-31-20-7-9-21(10-8-20)32(29,30)25-23-14-17(22-15-19(27)6-11-24(22)28)4-5-18(23)16-26-12-2-3-13-26/h4-11,14-15,25H,2-3,12-13,16H2,1H3

Standard InChI Key:  DQTXBDPNXDEVFH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   18.2206  -26.9705    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6373  -27.6871    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.0496  -26.9680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7817  -26.8662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7806  -27.6937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4953  -28.1065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2118  -27.6931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2090  -26.8626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4935  -26.4535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0693  -28.1032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3554  -27.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6426  -28.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6378  -28.9218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3517  -29.3370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0706  -28.9269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3580  -26.8630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3483  -30.1620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9218  -26.4475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9268  -28.1045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9187  -25.6225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5809  -25.1348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3231  -24.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4980  -24.3543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2462  -25.1398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3558  -28.1023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3524  -28.9257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0667  -29.3370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7815  -28.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7775  -28.0940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0627  -27.6865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4972  -29.3338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2104  -28.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  1  0
 10 15  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  1  0
  5 10  1  0
 11 16  2  0
 14 17  2  0
  8 18  1  0
  7 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
 19  2  1  0
  2 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4648318

    ---

Associated Targets(Human)

SETD7 Tchem Histone-lysine N-methyltransferase SETD7 (390 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.53Molecular Weight (Monoisotopic): 452.1406AlogP: 3.18#Rotatable Bonds: 7
Polar Surface Area: 92.78Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.87CX Basic pKa: 6.21CX LogP: 3.25CX LogD: 3.22
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.65Np Likeness Score: -0.61

References

1. Hou Z, Min W, Zhang R, Niu A, Li Y, Cao L, Han J, Luo C, Yang P, Ding H..  (2020)  Lead discovery, chemical optimization, and biological evaluation studies of novel histone methyltransferase SET7 small-molecule inhibitors.,  30  (9): [PMID:32173197] [10.1016/j.bmcl.2020.127061]

Source