The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(3,6-dioxocyclohexa-1,4-dienyl)-2-(pyrrolidin-1-ylmethyl)phenyl)-4-methoxybenzenesulfonamide ID: ALA4648318
PubChem CID: 156021418
Max Phase: Preclinical
Molecular Formula: C24H24N2O5S
Molecular Weight: 452.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)Nc2cc(C3=CC(=O)C=CC3=O)ccc2CN2CCCC2)cc1
Standard InChI: InChI=1S/C24H24N2O5S/c1-31-20-7-9-21(10-8-20)32(29,30)25-23-14-17(22-15-19(27)6-11-24(22)28)4-5-18(23)16-26-12-2-3-13-26/h4-11,14-15,25H,2-3,12-13,16H2,1H3
Standard InChI Key: DQTXBDPNXDEVFH-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
18.2206 -26.9705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.6373 -27.6871 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.0496 -26.9680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7817 -26.8662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7806 -27.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4953 -28.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2118 -27.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2090 -26.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4935 -26.4535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0693 -28.1032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3554 -27.6880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6426 -28.0965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6378 -28.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3517 -29.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0706 -28.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3580 -26.8630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3483 -30.1620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9218 -26.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9268 -28.1045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9187 -25.6225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5809 -25.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3231 -24.3512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4980 -24.3543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2462 -25.1398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3558 -28.1023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3524 -28.9257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0667 -29.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7815 -28.9233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7775 -28.0940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0627 -27.6865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4972 -29.3338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.2104 -28.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 15 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
5 10 1 0
11 16 2 0
14 17 2 0
8 18 1 0
7 19 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
19 2 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.53Molecular Weight (Monoisotopic): 452.1406AlogP: 3.18#Rotatable Bonds: 7Polar Surface Area: 92.78Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.87CX Basic pKa: 6.21CX LogP: 3.25CX LogD: 3.22Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.65Np Likeness Score: -0.61
References 1. Hou Z, Min W, Zhang R, Niu A, Li Y, Cao L, Han J, Luo C, Yang P, Ding H.. (2020) Lead discovery, chemical optimization, and biological evaluation studies of novel histone methyltransferase SET7 small-molecule inhibitors., 30 (9): [PMID:32173197 ] [10.1016/j.bmcl.2020.127061 ]