4-(4-chlorophenylselanyl)butyl 5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanoate

ID: ALA4648356

PubChem CID: 156021767

Max Phase: Preclinical

Molecular Formula: C20H27ClN2O3SSe

Molecular Weight: 489.93

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1N[C@H]2[C@H](CS[C@H]2CCCCC(=O)OCCCC[Se]c2ccc(Cl)cc2)N1

Standard InChI:  InChI=1S/C20H27ClN2O3SSe/c21-14-7-9-15(10-8-14)28-12-4-3-11-26-18(24)6-2-1-5-17-19-16(13-27-17)22-20(25)23-19/h7-10,16-17,19H,1-6,11-13H2,(H2,22,23,25)/t16-,17-,19-/m0/s1

Standard InChI Key:  PZUWQLHEEJARIA-LNLFQRSKSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    6.2996   -4.8980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9506   -5.3813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6302   -5.3555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6795   -6.1603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8624   -6.1444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2464   -7.4109    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.9200   -6.9494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5957   -6.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3239   -4.0770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4950   -6.1578    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0435   -6.1372    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6230   -7.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3305   -6.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0384   -7.3540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7459   -6.9450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4538   -7.3532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1613   -6.9443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4543   -8.1704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8692   -7.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5767   -6.9435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2847   -7.3518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9922   -6.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7001   -7.3510    0.0000 Se  0  0  0  0  0  2  0  0  0  0  0  0
   15.4076   -6.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1147   -7.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8217   -6.9454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8217   -6.1274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1088   -5.7193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4047   -6.1299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5287   -5.7175    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  3  1  0
  6  8  1  0
  7  4  1  0
  8  5  1  0
  9  1  2  0
  4  5  1  0
  7  6  1  0
  4 10  1  1
  5 11  1  1
  7 12  1  6
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4648356

    ---

Associated Targets(Human)

5637 (630 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 489.93Molecular Weight (Monoisotopic): 490.0596AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Leitemberger A, Sonego MS, Garcia FD, Dos Santos ACF, Piccoli BC, da Silva FD, Oliveira CS, Seixas FK, Dornelles L, Rocha JBT, Nogara PA, Schachtschneider KM, Collares T, Rodrigues OED..  (2020)  Synthesis and biological evaluation of new antioxidant and antiproliferative chalcogenobiotin derivatives for bladder carcinoma treatment.,  28  (9): [PMID:32205047] [10.1016/j.bmc.2020.115423]

Source