The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Fluoro[(2S)-3-{[(9Z)-hexadec-9-enoyl]oxy}-2-methoxypropyl]propanedioic acid ID: ALA4648374
PubChem CID: 156020178
Max Phase: Preclinical
Molecular Formula: C23H39FO7
Molecular Weight: 446.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCC/C=C\CCCCCCCC(=O)OC[C@H](CC(F)(C(=O)O)C(=O)O)OC
Standard InChI: InChI=1S/C23H39FO7/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(25)31-18-19(30-2)17-23(24,21(26)27)22(28)29/h8-9,19H,3-7,10-18H2,1-2H3,(H,26,27)(H,28,29)/b9-8-/t19-/m0/s1
Standard InChI Key: LVBNGOSRIOTEDK-QWUACUGRSA-N
Molfile:
RDKit 2D
31 30 0 0 0 0 0 0 0 0999 V2000
26.2304 -17.1678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9416 -16.7539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6541 -17.1656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3653 -16.7517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0778 -17.1633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7889 -16.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5014 -17.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2085 -16.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9210 -17.1589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.2072 -15.9260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5213 -16.7616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8150 -17.1726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8178 -17.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1115 -18.4008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4024 -17.9946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6960 -18.4056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9870 -17.9994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2806 -18.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6288 -16.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3364 -17.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0442 -16.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7518 -17.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4596 -16.7513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1672 -17.1601 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4598 -15.9341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7516 -17.9769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0437 -18.3853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4592 -18.3857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.7471 -16.3397 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.3362 -17.9765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6283 -18.3849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
1 11 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
9 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 25 2 0
22 26 1 0
26 27 1 0
26 28 2 0
22 29 1 0
20 30 1 6
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.56Molecular Weight (Monoisotopic): 446.2680AlogP: 5.07#Rotatable Bonds: 20Polar Surface Area: 110.13Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.39CX Basic pKa: ┄CX LogP: 5.86CX LogD: 0.38Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.12Np Likeness Score: 0.76
References 1. González-Gil I, Zian D, Vázquez-Villa H, Hernández-Torres G, Martínez RF, Khiar-Fernández N, Rivera R, Kihara Y, Devesa I, Mathivanan S, Del Valle CR, Zambrana-Infantes E, Puigdomenech M, Cincilla G, Sanchez-Martinez M, Rodríguez de Fonseca F, Ferrer-Montiel AV, Chun J, López-Vales R, López-Rodríguez ML, Ortega-Gutiérrez S.. (2020) A Novel Agonist of the Type 1 Lysophosphatidic Acid Receptor (LPA1 ), UCM-05194, Shows Efficacy in Neuropathic Pain Amelioration., 63 (5): [PMID:31790581 ] [10.1021/acs.jmedchem.9b01287 ]