The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4648572
PubChem CID: 156021051
Max Phase: Preclinical
Molecular Formula: C24H30N4O2S
Molecular Weight: 438.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)NC(=S)NCC1=C[C@]2(CC)CCCN3CCc4c(n1c1ccccc41)[C@@H]32
Standard InChI: InChI=1S/C24H30N4O2S/c1-3-24-11-7-12-27-13-10-18-17-8-5-6-9-19(17)28(20(18)21(24)27)16(14-24)15-25-22(31)26-23(29)30-4-2/h5-6,8-9,14,21H,3-4,7,10-13,15H2,1-2H3,(H2,25,26,29,31)/t21-,24+/m1/s1
Standard InChI Key: WFENYEJLVHBUFZ-QPPBQGQZSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
15.1203 -11.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5309 -11.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8256 -10.7301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1203 -11.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4214 -13.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1267 -13.5832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8216 -12.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8318 -13.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5351 -13.5695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2328 -13.1576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2226 -12.3469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5147 -11.9481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4219 -12.3688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7141 -13.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8674 -11.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3391 -10.9007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0009 -10.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1911 -10.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7207 -10.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0616 -11.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8155 -11.5439 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.8238 -13.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5274 -14.4069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7151 -14.4053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.0078 -14.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2996 -14.4069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5924 -14.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0087 -15.6319 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.8842 -14.4085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5933 -15.6335 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1770 -14.8178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4688 -14.4100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 4 2 0
1 3 1 0
12 2 1 0
2 3 1 0
7 4 1 0
13 5 1 0
5 6 2 0
6 8 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
13 4 1 0
1 16 1 0
15 13 1 0
5 14 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
7 21 1 6
8 22 1 6
22 23 1 0
14 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 2 0
27 29 1 0
27 30 2 0
29 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.60Molecular Weight (Monoisotopic): 438.2089AlogP: 4.21#Rotatable Bonds: 4Polar Surface Area: 58.53Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.63CX Basic pKa: 7.16CX LogP: 3.94CX LogD: 3.86Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.70Np Likeness Score: 0.07
References 1. Pan BW, Shi Y, Li WC, Wang Q, Pan M, Wu Q, Fu HZ.. (2020) Synthesis and biological evaluation of Vinpocetine derivatives., 30 (2): [PMID:31859156 ] [10.1016/j.bmcl.2019.05.052 ]