The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
serratamolide A ID: ALA464858
Cas Number: 5285-25-6
PubChem CID: 168994
Max Phase: Preclinical
Molecular Formula: C26H46N2O8
Molecular Weight: 514.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCC[C@@H]1CC(=O)N[C@@H](CO)C(=O)O[C@H](CCCCCCC)CC(=O)N[C@@H](CO)C(=O)O1
Standard InChI: InChI=1S/C26H46N2O8/c1-3-5-7-9-11-13-19-15-23(31)27-22(18-30)26(34)36-20(14-12-10-8-6-4-2)16-24(32)28-21(17-29)25(33)35-19/h19-22,29-30H,3-18H2,1-2H3,(H,27,31)(H,28,32)/t19-,20-,21+,22+/m1/s1
Standard InChI Key: NMEMNUVHBNAERZ-CZYKHXBRSA-N
Molfile:
RDKit 2D
36 36 0 0 0 0 0 0 0 0999 V2000
11.3829 -5.0543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6971 -5.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0981 -5.4676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8392 -6.3506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0230 -6.2841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0935 -6.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7982 -6.5814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1362 -7.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8374 -7.4062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9151 -7.8348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0948 -7.7712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8464 -8.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2448 -8.5770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5672 -9.0595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4719 -8.0369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9345 -5.2236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4667 -6.0981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0097 -8.8861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3827 -6.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6646 -6.7022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.5479 -7.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2663 -7.4199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1161 -9.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8308 -5.0885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5254 -5.5335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2581 -5.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9529 -5.5992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6856 -5.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4186 -8.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6884 -8.9746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9909 -8.5339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2606 -8.9176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3803 -5.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1130 -5.2858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5631 -8.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8338 -8.8609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 17 2 0
2 4 1 0
13 18 2 0
3 5 1 0
6 19 1 6
4 6 1 0
19 20 1 0
5 7 1 0
9 21 1 6
6 8 1 0
21 22 1 0
7 9 1 0
12 23 1 1
8 10 1 0
3 24 1 1
9 11 1 0
24 25 1 0
12 10 1 0
25 26 1 0
11 13 1 0
26 27 1 0
12 14 1 0
27 28 1 0
13 14 1 0
28 33 1 0
23 29 1 0
8 15 2 0
29 30 1 0
1 2 1 0
30 31 1 0
2 16 2 0
31 32 1 0
1 3 1 0
32 35 1 0
33 34 1 0
35 36 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.66Molecular Weight (Monoisotopic): 514.3254AlogP: 2.28#Rotatable Bonds: 14Polar Surface Area: 151.26Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.55CX Basic pKa: ┄CX LogP: 2.88CX LogD: 2.88Aromatic Rings: ┄Heavy Atoms: 36QED Weighted: 0.20Np Likeness Score: 1.10
References 1. Dwivedi D, Jansen R, Molinari G, Nimtz M, Johri BN, Wray V.. (2008) Antimycobacterial serratamolides and diacyl peptoglucosamine derivatives from Serratia sp., 71 (4): [PMID:18303848 ] [10.1021/np7007126 ]