Fluoro[(2S)-2-methoxy-3-{[(9Z)-octadec-9-enoyl]oxy}propyl]propanedioic Acid

ID: ALA4648653

PubChem CID: 156020199

Max Phase: Preclinical

Molecular Formula: C25H43FO7

Molecular Weight: 474.61

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](CC(F)(C(=O)O)C(=O)O)OC

Standard InChI:  InChI=1S/C25H43FO7/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(27)33-20-21(32-2)19-25(26,23(28)29)24(30)31/h10-11,21H,3-9,12-20H2,1-2H3,(H,28,29)(H,30,31)/b11-10-/t21-/m0/s1

Standard InChI Key:  VSLGNBVETXWRGU-XPTLAUCJSA-N

Molfile:  

 
     RDKit          2D

 33 32  0  0  0  0  0  0  0  0999 V2000
   27.3943  -24.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1055  -24.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8180  -24.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5292  -24.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2416  -24.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9528  -24.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6653  -24.6438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3724  -24.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0848  -24.6416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.3711  -23.4086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6852  -24.2442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9789  -24.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9817  -25.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2753  -25.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5662  -25.4772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8599  -25.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1508  -25.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4445  -25.8930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7927  -24.2332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5003  -24.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2081  -24.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9157  -24.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6235  -24.2339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3311  -24.6427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6237  -23.4168    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.9154  -25.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2076  -25.8679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6230  -25.8683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.9110  -23.8224    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.5000  -25.4591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.7922  -25.8675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7354  -25.4868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0291  -25.8978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  1 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  9 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 22 26  1  0
 26 27  1  0
 26 28  2  0
 22 29  1  0
 20 30  1  6
 30 31  1  0
 18 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4648653

    ---

Associated Targets(Human)

LPAR1 Tchem Lysophosphatidic acid receptor Edg-2 (779 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.61Molecular Weight (Monoisotopic): 474.2993AlogP: 5.85#Rotatable Bonds: 22
Polar Surface Area: 110.13Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 2.39CX Basic pKa: CX LogP: 6.75CX LogD: 1.27
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.09Np Likeness Score: 0.71

References

1. González-Gil I, Zian D, Vázquez-Villa H, Hernández-Torres G, Martínez RF, Khiar-Fernández N, Rivera R, Kihara Y, Devesa I, Mathivanan S, Del Valle CR, Zambrana-Infantes E, Puigdomenech M, Cincilla G, Sanchez-Martinez M, Rodríguez de Fonseca F, Ferrer-Montiel AV, Chun J, López-Vales R, López-Rodríguez ML, Ortega-Gutiérrez S..  (2020)  A Novel Agonist of the Type 1 Lysophosphatidic Acid Receptor (LPA1), UCM-05194, Shows Efficacy in Neuropathic Pain Amelioration.,  63  (5): [PMID:31790581] [10.1021/acs.jmedchem.9b01287]

Source