The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[[3-[3,5-bis[(4-chlorophenyl)methylene]-4-oxo-piperidine-1-carbonyl]-4-fluoro-phenyl]methyl]-2H-phthalazin-1-one ID: ALA4648701
PubChem CID: 156020627
Max Phase: Preclinical
Molecular Formula: C35H24Cl2FN3O3
Molecular Weight: 624.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1/C(=C/c2ccc(Cl)cc2)CN(C(=O)c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)C/C1=C\c1ccc(Cl)cc1
Standard InChI: InChI=1S/C35H24Cl2FN3O3/c36-26-10-5-21(6-11-26)15-24-19-41(20-25(33(24)42)16-22-7-12-27(37)13-8-22)35(44)30-17-23(9-14-31(30)38)18-32-28-3-1-2-4-29(28)34(43)40-39-32/h1-17H,18-20H2,(H,40,43)/b24-15+,25-16+
Standard InChI Key: QGLXPPAQTLGFSX-FEZYOMQXSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
14.9061 -3.7846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9050 -4.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6130 -5.0131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6112 -3.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3199 -3.7810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3187 -4.6062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0288 -5.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7446 -4.6083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7458 -3.7831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0311 -3.3672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0312 -2.5500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0265 -5.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7330 -6.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7255 -7.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4312 -7.4732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1411 -7.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1408 -6.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4345 -5.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8482 -7.4762 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.8482 -5.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5562 -6.2442 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8476 -5.0189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5520 -7.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2559 -7.4661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9657 -7.0605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9671 -6.2424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2587 -5.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6722 -7.4713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6759 -5.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6781 -5.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2534 -8.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5444 -8.6898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3853 -4.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3879 -3.7984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6807 -3.3870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9696 -3.7981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9705 -4.6132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8397 -8.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1312 -8.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1282 -9.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8397 -9.9122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5452 -9.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6819 -2.5698 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.4198 -9.9090 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
7 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
17 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
21 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 2 0
26 29 2 0
29 30 1 0
24 31 2 0
31 32 1 0
30 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 30 1 0
32 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 32 1 0
35 43 1 0
40 44 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 624.50Molecular Weight (Monoisotopic): 623.1179AlogP: 7.15#Rotatable Bonds: 5Polar Surface Area: 83.13Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.96CX Basic pKa: ┄CX LogP: 7.41CX LogD: 7.41Aromatic Rings: 5Heavy Atoms: 44QED Weighted: 0.21Np Likeness Score: -1.05
References 1. Lin S, Zhang L, Zhang X, Yu Z, Huang X, Xu J, Liu Y, Chen L, Wu L.. (2020) Synthesis of novel dual target inhibitors of PARP and HSP90 and their antitumor activities., 28 (9): [PMID:32222339 ] [10.1016/j.bmc.2020.115434 ]