The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
serratamolide E ID: ALA464876
PubChem CID: 24862330
Max Phase: Preclinical
Molecular Formula: C24H42N2O8
Molecular Weight: 486.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Serratamolide E | CHEMBL464876
Canonical SMILES: CCCCCCC[C@@H]1CC(=O)N[C@@H](CO)C(=O)O[C@H](CCCCC)CC(=O)N[C@@H](CO)C(=O)O1
Standard InChI: InChI=1S/C24H42N2O8/c1-3-5-7-8-10-12-18-14-22(30)26-19(15-27)23(31)33-17(11-9-6-4-2)13-21(29)25-20(16-28)24(32)34-18/h17-20,27-28H,3-16H2,1-2H3,(H,25,29)(H,26,30)/t17-,18-,19+,20+/m1/s1
Standard InChI Key: PTVPABPUSZNBMJ-ZRNYENFQSA-N
Molfile:
RDKit 2D
34 34 0 0 0 0 0 0 0 0999 V2000
10.5434 -4.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8576 -4.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2586 -4.7895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9997 -5.6724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1835 -5.6059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2540 -6.0368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9586 -5.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2967 -6.8695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9979 -6.7280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0756 -7.1566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2553 -7.0931 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0069 -7.9696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4052 -7.8988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7277 -8.3813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6324 -7.3586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0950 -4.5455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6271 -5.4198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1701 -8.2078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5432 -5.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8251 -6.0240 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7083 -7.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4267 -6.7417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2766 -8.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9913 -4.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6859 -4.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4185 -4.4761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5791 -7.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8489 -8.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1514 -7.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4212 -8.2394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7237 -7.7988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9983 -8.1826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1133 -4.9210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8460 -4.5418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 16 2 0
1 3 1 0
7 17 2 0
2 4 1 0
13 18 2 0
3 5 1 0
6 19 1 6
4 6 1 0
19 20 1 0
5 7 1 0
9 21 1 6
6 8 1 0
21 22 1 0
7 9 1 0
12 23 1 1
8 10 1 0
3 24 1 1
9 11 1 0
24 25 1 0
12 10 1 0
25 26 1 0
11 13 1 0
26 33 1 0
12 14 1 0
23 27 1 0
13 14 1 0
27 28 1 0
28 29 1 0
8 15 2 0
29 30 1 0
1 2 1 0
30 31 1 0
31 32 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.61Molecular Weight (Monoisotopic): 486.2941AlogP: 1.50#Rotatable Bonds: 12Polar Surface Area: 151.26Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.60CX Basic pKa: ┄CX LogP: 1.99CX LogD: 1.99Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.24Np Likeness Score: 1.17
References 1. Dwivedi D, Jansen R, Molinari G, Nimtz M, Johri BN, Wray V.. (2008) Antimycobacterial serratamolides and diacyl peptoglucosamine derivatives from Serratia sp., 71 (4): [PMID:18303848 ] [10.1021/np7007126 ]