The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
trans-methyl (1R,3S)-1-octyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate ID: ALA4648769
PubChem CID: 156021523
Max Phase: Preclinical
Molecular Formula: C21H30N2O2
Molecular Weight: 342.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC[C@H]1N[C@H](C(=O)OC)Cc2c1[nH]c1ccccc21
Standard InChI: InChI=1S/C21H30N2O2/c1-3-4-5-6-7-8-13-18-20-16(14-19(22-18)21(24)25-2)15-11-9-10-12-17(15)23-20/h9-12,18-19,22-23H,3-8,13-14H2,1-2H3/t18-,19+/m1/s1
Standard InChI Key: FYHDKKBRSLVJIZ-MOPGFXCFSA-N
Molfile:
RDKit 2D
25 27 0 0 0 0 0 0 0 0999 V2000
3.1218 -10.3681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4421 -9.9085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6706 -9.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1091 -8.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3147 -8.7262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0850 -9.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6522 -10.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4913 -9.0944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7713 -9.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5755 -10.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1055 -9.3875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8297 -8.6136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0197 -8.4657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3628 -7.9907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1709 -8.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0838 -7.2171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4458 -8.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8501 -10.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6581 -10.9343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9327 -11.7080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4035 -12.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5955 -12.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0621 -12.8105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2541 -12.6635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9795 -11.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 9 1 0
8 3 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 1 1
14 15 1 0
14 16 2 0
15 17 1 0
10 18 1 6
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 342.48Molecular Weight (Monoisotopic): 342.2307AlogP: 4.65#Rotatable Bonds: 8Polar Surface Area: 54.12Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.50CX LogP: 5.03CX LogD: 5.03Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.54Np Likeness Score: 0.64
References 1. Singh R, Jaisingh A, Maurya IK, Salunke DB.. (2020) Design, synthesis and bio-evaluation of C-1 alkylated tetrahydro-β-carboline derivatives as novel antifungal lead compounds., 30 (3): [PMID:31870647 ] [10.1016/j.bmcl.2019.126869 ] 2. Dai JK, Dan WJ, Wan JB.. (2022) Natural and synthetic β-carboline as a privileged antifungal scaffolds., 229 [PMID:34954591 ] [10.1016/j.ejmech.2021.114057 ]