[2-[6-amino-4-(trifluoromethyl)-3-pyridyl]-4-morpholino-pyrrolo[2,1-f][1,2,4]triazin-6-yl]-(4-ethylpiperazin-1-yl)methanone

ID: ALA4648855

PubChem CID: 156020439

Max Phase: Preclinical

Molecular Formula: C23H27F3N8O2

Molecular Weight: 504.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN1CCN(C(=O)c2cc3c(N4CCOCC4)nc(-c4cnc(N)cc4C(F)(F)F)nn3c2)CC1

Standard InChI:  InChI=1S/C23H27F3N8O2/c1-2-31-3-5-33(6-4-31)22(35)15-11-18-21(32-7-9-36-10-8-32)29-20(30-34(18)14-15)16-13-28-19(27)12-17(16)23(24,25)26/h11-14H,2-10H2,1H3,(H2,27,28)

Standard InChI Key:  PGAJLSSJQKFGCL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    1.8324   -7.0921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5445   -6.6808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2528   -7.0916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2528   -7.9152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5471   -8.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8324   -7.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1252   -8.3252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9599   -8.3240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6712   -7.9152    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.9599   -9.1418    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.6712   -8.7329    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.9650   -6.6798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9653   -5.8603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6750   -5.4512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3875   -5.8631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3898   -6.6809    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6774   -7.0941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1676   -6.9313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6439   -6.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1641   -5.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4617   -6.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8705   -5.5615    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4617   -4.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8705   -4.1432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6883   -4.1432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0971   -4.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6883   -5.5615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0971   -3.4360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6883   -2.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8705   -6.9758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6750   -4.6334    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9679   -4.2246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9679   -3.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6751   -2.9980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3822   -3.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3822   -4.2245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
 12  3  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 12 17  2  0
 16 18  1  0
 19 18  2  0
 20 19  1  0
 15 20  2  0
 19 21  1  0
 21 22  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
 22 27  1  0
 25 28  1  0
 28 29  1  0
 21 30  2  0
 14 31  1  0
 32 31  1  0
 33 32  1  0
 34 33  1  0
 35 34  1  0
 36 35  1  0
 31 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4648855

    ---

Associated Targets(Human)

SJRH30 (203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 504.52Molecular Weight (Monoisotopic): 504.2209AlogP: 2.01#Rotatable Bonds: 4
Polar Surface Area: 105.12Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.04CX LogP: 2.74CX LogD: 2.58
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.58Np Likeness Score: -1.53

References

1. Xiang HY, Chen YH, Wang Y, Zhang X, Ding J, Meng LH, Yang CH..  (2020)  Design, synthesis and antiproliferative activity evaluation of a series of pyrrolo[2,1-f][1,2,4]triazine derivatives.,  30  (12): [PMID:32317209] [10.1016/j.bmcl.2020.127194]

Source