The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[2-[6-amino-4-(trifluoromethyl)-3-pyridyl]-4-morpholino-pyrrolo[2,1-f][1,2,4]triazin-6-yl]-(4-ethylpiperazin-1-yl)methanone ID: ALA4648855
PubChem CID: 156020439
Max Phase: Preclinical
Molecular Formula: C23H27F3N8O2
Molecular Weight: 504.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN1CCN(C(=O)c2cc3c(N4CCOCC4)nc(-c4cnc(N)cc4C(F)(F)F)nn3c2)CC1
Standard InChI: InChI=1S/C23H27F3N8O2/c1-2-31-3-5-33(6-4-31)22(35)15-11-18-21(32-7-9-36-10-8-32)29-20(30-34(18)14-15)16-13-28-19(27)12-17(16)23(24,25)26/h11-14H,2-10H2,1H3,(H2,27,28)
Standard InChI Key: PGAJLSSJQKFGCL-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
1.8324 -7.0921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5445 -6.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2528 -7.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2528 -7.9152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5471 -8.3258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8324 -7.9163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1252 -8.3252 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9599 -8.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6712 -7.9152 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.9599 -9.1418 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.6712 -8.7329 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.9650 -6.6798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9653 -5.8603 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6750 -5.4512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3875 -5.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3898 -6.6809 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6774 -7.0941 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1676 -6.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6439 -6.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1641 -5.6085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4617 -6.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8705 -5.5615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4617 -4.8503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8705 -4.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6883 -4.1432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0971 -4.8503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6883 -5.5615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0971 -3.4360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6883 -2.7314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8705 -6.9758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6750 -4.6334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9679 -4.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9679 -3.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6751 -2.9980 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3822 -3.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3822 -4.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
4 8 1 0
8 9 1 0
8 10 1 0
8 11 1 0
12 3 1 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 1 0
17 16 1 0
12 17 2 0
16 18 1 0
19 18 2 0
20 19 1 0
15 20 2 0
19 21 1 0
21 22 1 0
23 22 1 0
24 23 1 0
25 24 1 0
26 25 1 0
27 26 1 0
22 27 1 0
25 28 1 0
28 29 1 0
21 30 2 0
14 31 1 0
32 31 1 0
33 32 1 0
34 33 1 0
35 34 1 0
36 35 1 0
31 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 504.52Molecular Weight (Monoisotopic): 504.2209AlogP: 2.01#Rotatable Bonds: 4Polar Surface Area: 105.12Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.04CX LogP: 2.74CX LogD: 2.58Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.58Np Likeness Score: -1.53
References 1. Xiang HY, Chen YH, Wang Y, Zhang X, Ding J, Meng LH, Yang CH.. (2020) Design, synthesis and antiproliferative activity evaluation of a series of pyrrolo[2,1-f][1,2,4]triazine derivatives., 30 (12): [PMID:32317209 ] [10.1016/j.bmcl.2020.127194 ]