O-((41S,13aS)-13a-ethyl-2,3,41,5,6,13a-hexahydro-1H-indolo[3,2,1-de]pyrido[3,2,1-ij][1,5]naphthyridin-12-yl)methyl 3-(trifluoromethyl)phenylcarbamothioate

ID: ALA4648949

PubChem CID: 156021527

Max Phase: Preclinical

Molecular Formula: C28H28F3N3OS

Molecular Weight: 511.61

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@@]12C=C(COC(=S)Nc3cccc(C(F)(F)F)c3)n3c4c(c5ccccc53)CCN(CCC1)[C@H]42

Standard InChI:  InChI=1S/C28H28F3N3OS/c1-2-27-12-6-13-33-14-11-22-21-9-3-4-10-23(21)34(24(22)25(27)33)20(16-27)17-35-26(36)32-19-8-5-7-18(15-19)28(29,30)31/h3-5,7-10,15-16,25H,2,6,11-14,17H2,1H3,(H,32,36)/t25-,27+/m1/s1

Standard InChI Key:  WPLCPJRUWZWKHC-VPUSJEBWSA-N

Molfile:  

 
     RDKit          2D

 37 42  0  0  0  0  0  0  0  0999 V2000
   33.7506   -2.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1612   -2.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4559   -2.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7506   -3.5404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0517   -4.7592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7570   -5.1636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4519   -3.9450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4621   -4.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1654   -5.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8631   -4.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8529   -3.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1450   -3.5286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0522   -3.9493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3444   -5.1686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6363   -4.7608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.4977   -3.1440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9695   -2.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6312   -1.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8214   -1.6670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3510   -2.3347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6919   -3.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4458   -3.1243    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   34.4541   -5.5718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1578   -5.9873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9290   -5.1701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2209   -4.7623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9299   -5.9873    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   29.5136   -5.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8061   -4.7613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0993   -5.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0998   -5.9881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8129   -6.3957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5168   -5.9847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3913   -4.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3908   -3.9447    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.6839   -5.1709    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.3842   -5.5759    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  1  3  1  0
 12  2  1  0
  2  3  1  0
  7  4  1  0
 13  5  1  0
  5  6  2  0
  6  8  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13  4  1  0
  1 17  1  0
 16 13  1  0
  5 14  1  0
 14 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  7 22  1  6
  8 23  1  6
 23 24  1  0
 15 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 30 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4648949

    ---

Associated Targets(Human)

PDE1A Tclin Phosphodiesterase 1A (251 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 511.61Molecular Weight (Monoisotopic): 511.1905AlogP: 7.02#Rotatable Bonds: 4
Polar Surface Area: 29.43Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 6.47CX Basic pKa: 7.20CX LogP: 6.16CX LogD: 6.08
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -0.13

References

1. Pan BW, Shi Y, Li WC, Wang Q, Pan M, Wu Q, Fu HZ..  (2020)  Synthesis and biological evaluation of Vinpocetine derivatives.,  30  (2): [PMID:31859156] [10.1016/j.bmcl.2019.05.052]

Source