2-[6-amino-4-(trifluoromethyl)-3-pyridyl]-N-[3-(dimethylamino)propyl]-4-morpholino-pyrrolo[2,1-f][1,2,4]triazine-6-carboxamide

ID: ALA4648964

PubChem CID: 156021792

Max Phase: Preclinical

Molecular Formula: C22H27F3N8O2

Molecular Weight: 492.51

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)CCCNC(=O)c1cc2c(N3CCOCC3)nc(-c3cnc(N)cc3C(F)(F)F)nn2c1

Standard InChI:  InChI=1S/C22H27F3N8O2/c1-31(2)5-3-4-27-21(34)14-10-17-20(32-6-8-35-9-7-32)29-19(30-33(17)13-14)15-12-28-18(26)11-16(15)22(23,24)25/h10-13H,3-9H2,1-2H3,(H2,26,28)(H,27,34)

Standard InChI Key:  XEFVNTZPRCUYMR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    2.4953  -17.0950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2074  -16.6836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9157  -17.0944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9157  -17.9180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2100  -18.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4953  -17.9191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7881  -18.3280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6228  -18.3269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3341  -17.9180    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.6228  -19.1446    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.3341  -18.7358    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.6279  -16.6827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6282  -15.8631    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3379  -15.4540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0504  -15.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0527  -16.6796    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3444  -17.0970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8305  -16.9342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3109  -16.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8270  -15.6114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1287  -16.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5375  -15.5603    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3553  -15.5603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7642  -14.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5819  -14.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9908  -14.1460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8044  -14.1460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5819  -13.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5375  -16.9787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3379  -14.6363    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6308  -14.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6308  -13.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3380  -13.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0451  -13.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0451  -14.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  4  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
 12  3  1  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 12 17  2  0
 16 18  1  0
 19 18  2  0
 20 19  1  0
 15 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  1  0
 21 29  2  0
 14 30  1  0
 31 30  1  0
 32 31  1  0
 33 32  1  0
 34 33  1  0
 35 34  1  0
 30 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4648964

    ---

Associated Targets(Human)

SJRH30 (203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 492.51Molecular Weight (Monoisotopic): 492.2209AlogP: 1.91#Rotatable Bonds: 7
Polar Surface Area: 113.91Molecular Species: BASEHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.30CX LogP: 2.40CX LogD: 0.50
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.48Np Likeness Score: -1.39

References

1. Xiang HY, Chen YH, Wang Y, Zhang X, Ding J, Meng LH, Yang CH..  (2020)  Design, synthesis and antiproliferative activity evaluation of a series of pyrrolo[2,1-f][1,2,4]triazine derivatives.,  30  (12): [PMID:32317209] [10.1016/j.bmcl.2020.127194]

Source