The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-((4-(1H-Pyrazol-4-yl)phenyl)amino)-5,7-dihydrofuro[3,4-d]pyrimidin-2-yl)phenoxy)-N-cyclopropylacetamide ID: ALA4649021
PubChem CID: 138592826
Max Phase: Preclinical
Molecular Formula: C26H24N6O3
Molecular Weight: 468.52
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(COc1cccc(-c2nc3c(c(Nc4ccc(-c5cn[nH]c5)cc4)n2)COC3)c1)NC1CC1
Standard InChI: InChI=1S/C26H24N6O3/c33-24(29-19-8-9-19)15-35-21-3-1-2-17(10-21)25-31-23-14-34-13-22(23)26(32-25)30-20-6-4-16(5-7-20)18-11-27-28-12-18/h1-7,10-12,19H,8-9,13-15H2,(H,27,28)(H,29,33)(H,30,31,32)
Standard InChI Key: RYJMJCJWMWMLJV-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
3.9495 -27.3662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6633 -26.9526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6604 -26.1258 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9477 -25.7206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9453 -24.8993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6559 -24.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3668 -24.8974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0728 -24.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0708 -23.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3569 -23.2548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6497 -23.6671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7753 -23.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5274 -23.5802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0758 -22.9664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6599 -22.2563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8573 -22.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3722 -27.3635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3722 -28.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0797 -28.5933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7919 -28.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7880 -27.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0757 -26.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4977 -26.9417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2116 -27.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9213 -26.9345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9172 -26.1132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6353 -27.3436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3450 -26.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2373 -26.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2340 -26.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4523 -25.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9709 -26.5499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4577 -27.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1639 -26.9218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7476 -26.2120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 30 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 12 2 0
9 12 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
2 17 1 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 1 0
33 29 1 0
34 28 1 0
35 34 1 0
28 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.52Molecular Weight (Monoisotopic): 468.1910AlogP: 3.96#Rotatable Bonds: 8Polar Surface Area: 114.05Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.00CX LogP: 3.22CX LogD: 3.22Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -1.59
References 1. Liu KG, Kim JI, Olszewski K, Barsotti AM, Morris K, Lamarque C, Yu X, Gaffney J, Feng XJ, Patel JP, Poyurovsky MV.. (2020) Discovery and Optimization of Glucose Uptake Inhibitors., 63 (10): [PMID:32282207 ] [10.1021/acs.jmedchem.9b02153 ]