The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Amphiepicoccin C ID: ALA4649335
PubChem CID: 156020241
Max Phase: Preclinical
Molecular Formula: C19H20N2O6S3
Molecular Weight: 468.58
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CS[C@@]12C[C@H]3C(=O)C=C[C@H](O)[C@H]3N1C(=O)[C@@]13C[C@H]4C(=O)C[C@@H](SS1)[C@H](O)[C@H]4N3C2=O
Standard InChI: InChI=1S/C19H20N2O6S3/c1-28-18-5-7-9(22)2-3-10(23)13(7)20(18)17(27)19-6-8-11(24)4-12(29-30-19)15(25)14(8)21(19)16(18)26/h2-3,7-8,10,12-15,23,25H,4-6H2,1H3/t7-,8-,10-,12+,13-,14-,15-,18+,19+/m0/s1
Standard InChI Key: IXSAUCJJJVVUBK-FVCPCXLRSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
17.7425 -6.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4395 -5.9638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4395 -5.1549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7425 -4.7463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0455 -5.9638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0410 -5.1550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2780 -6.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7981 -5.5663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2694 -4.9147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9375 -4.1853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9990 -5.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6702 -4.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.1329 -4.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6597 -3.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9018 -4.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8966 -3.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2038 -3.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5156 -3.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5247 -4.5272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2181 -4.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5263 -6.1482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4115 -3.5268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5750 -5.3530 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.8626 -5.7286 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.0413 -6.7728 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.0331 -4.3460 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.7425 -7.1731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7436 -3.9374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1380 -4.7463 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.1975 -2.5024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2269 -5.7343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8964 -5.3283 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.8923 -2.8932 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.5349 -3.3885 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.1189 -2.6851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 4 1 0
5 1 1 0
1 2 1 0
2 3 1 0
3 4 1 0
5 6 1 0
6 9 1 0
8 7 1 0
7 5 1 0
8 9 1 0
8 11 1 0
9 10 1 0
10 13 1 0
12 11 1 0
12 13 1 0
13 14 1 0
14 16 1 0
15 12 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 15 1 0
11 21 2 0
10 22 2 0
8 23 1 6
3 24 1 0
23 24 1 0
5 25 1 1
6 26 1 1
1 27 2 0
4 28 1 1
3 29 1 6
17 30 2 0
20 31 1 1
15 32 1 1
16 33 1 1
13 34 1 6
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.58Molecular Weight (Monoisotopic): 468.0483AlogP: -0.21#Rotatable Bonds: 1Polar Surface Area: 115.22Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.69CX Basic pKa: ┄CX LogP: 0.48CX LogD: 0.48Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.50Np Likeness Score: 3.02
References 1. Wang Q, Zhang K, Wang W, Zhang G, Zhu T, Che Q, Gu Q, Li D.. (2020) Amphiepicoccins A-J: Epipolythiodioxopiperazines from the Fish-Gill-Derived Fungus Epicoccum nigrum HDN17-88., 83 (2): [PMID:31975590 ] [10.1021/acs.jnatprod.9b01242 ]