Amphiepicoccin C

ID: ALA4649335

PubChem CID: 156020241

Max Phase: Preclinical

Molecular Formula: C19H20N2O6S3

Molecular Weight: 468.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CS[C@@]12C[C@H]3C(=O)C=C[C@H](O)[C@H]3N1C(=O)[C@@]13C[C@H]4C(=O)C[C@@H](SS1)[C@H](O)[C@H]4N3C2=O

Standard InChI:  InChI=1S/C19H20N2O6S3/c1-28-18-5-7-9(22)2-3-10(23)13(7)20(18)17(27)19-6-8-11(24)4-12(29-30-19)15(25)14(8)21(19)16(18)26/h2-3,7-8,10,12-15,23,25H,4-6H2,1H3/t7-,8-,10-,12+,13-,14-,15-,18+,19+/m0/s1

Standard InChI Key:  IXSAUCJJJVVUBK-FVCPCXLRSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   17.7425   -6.3642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4395   -5.9638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4395   -5.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7425   -4.7463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0455   -5.9638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0410   -5.1550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2780   -6.2206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7981   -5.5663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2694   -4.9147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.9375   -4.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9990   -5.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6702   -4.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1329   -4.1020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6597   -3.4585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9018   -4.5128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8966   -3.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2038   -3.3196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5156   -3.7245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5247   -4.5272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2181   -4.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5263   -6.1482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4115   -3.5268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5750   -5.3530    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.8626   -5.7286    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.0413   -6.7728    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.0331   -4.3460    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.7425   -7.1731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7436   -3.9374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1380   -4.7463    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.1975   -2.5024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2269   -5.7343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8964   -5.3283    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.8923   -2.8932    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.5349   -3.3885    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.1189   -2.6851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  6  1  0
  6  9  1  0
  8  7  1  0
  7  5  1  0
  8  9  1  0
  8 11  1  0
  9 10  1  0
 10 13  1  0
 12 11  1  0
 12 13  1  0
 13 14  1  0
 14 16  1  0
 15 12  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 15  1  0
 11 21  2  0
 10 22  2  0
  8 23  1  6
  3 24  1  0
 23 24  1  0
  5 25  1  1
  6 26  1  1
  1 27  2  0
  4 28  1  1
  3 29  1  6
 17 30  2  0
 20 31  1  1
 15 32  1  1
 16 33  1  1
 13 34  1  6
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4649335

    ---

Associated Targets(non-human)

Human alphaherpesvirus 2 (4932 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.58Molecular Weight (Monoisotopic): 468.0483AlogP: -0.21#Rotatable Bonds: 1
Polar Surface Area: 115.22Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.69CX Basic pKa: CX LogP: 0.48CX LogD: 0.48
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.50Np Likeness Score: 3.02

References

1. Wang Q, Zhang K, Wang W, Zhang G, Zhu T, Che Q, Gu Q, Li D..  (2020)  Amphiepicoccins A-J: Epipolythiodioxopiperazines from the Fish-Gill-Derived Fungus Epicoccum nigrum HDN17-88.,  83  (2): [PMID:31975590] [10.1021/acs.jnatprod.9b01242]

Source