(R)-6-((1-(4-Chlorophenyl)ethyl)amino)-1-cyclopentyl-5-ethyl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one

ID: ALA4649440

PubChem CID: 156022066

Max Phase: Preclinical

Molecular Formula: C20H24ClN5O

Molecular Weight: 385.90

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCn1c(N[C@H](C)c2ccc(Cl)cc2)nc2c(cnn2C2CCCC2)c1=O

Standard InChI:  InChI=1S/C20H24ClN5O/c1-3-25-19(27)17-12-22-26(16-6-4-5-7-16)18(17)24-20(25)23-13(2)14-8-10-15(21)11-9-14/h8-13,16H,3-7H2,1-2H3,(H,23,24)/t13-/m1/s1

Standard InChI Key:  GTKXXNNPQLLFOF-CYBMUJFWSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   31.4041   -3.6856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.4041   -4.5069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1094   -4.9114    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1094   -3.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8188   -3.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8187   -4.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5967   -4.7549    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0792   -4.0925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5968   -3.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1094   -2.4474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6943   -3.2806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8484   -5.5287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3681   -6.1899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8486   -6.8510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6258   -6.5983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6255   -5.7811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6970   -4.9166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6982   -5.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9910   -6.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2863   -5.7317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5796   -6.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5804   -6.9587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2936   -7.3661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9974   -6.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8738   -7.3692    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   31.4065   -6.1413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6901   -2.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  4 10  2  0
  1 11  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
  7 12  1  0
  2 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
 18 26  1  6
 11 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4649440

    ---

Associated Targets(Human)

PDE1C Tclin Phosphodiesterase 1C (228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.90Molecular Weight (Monoisotopic): 385.1669AlogP: 4.55#Rotatable Bonds: 5
Polar Surface Area: 64.74Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.11CX LogP: 3.97CX LogD: 3.97
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.70Np Likeness Score: -1.72

References

1. Wu Y, Tian YJ, Le ML, Zhang SR, Zhang C, Huang MX, Jiang MY, Zhang B, Luo HB..  (2020)  Discovery of Novel Selective and Orally Bioavailable Phosphodiesterase-1 Inhibitors for the Efficient Treatment of Idiopathic Pulmonary Fibrosis.,  63  (14): [PMID:32603117] [10.1021/acs.jmedchem.0c00711]

Source