(S)-1-(tert-Butyl)-6-((2,3-dihydro-1H-inden-1-yl)amino)-5-(4-fluorobenzyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one

ID: ALA4649481

PubChem CID: 156022146

Max Phase: Preclinical

Molecular Formula: C25H26FN5O

Molecular Weight: 431.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)(C)n1ncc2c(=O)n(Cc3ccc(F)cc3)c(N[C@H]3CCc4ccccc43)nc21

Standard InChI:  InChI=1S/C25H26FN5O/c1-25(2,3)31-22-20(14-27-31)23(32)30(15-16-8-11-18(26)12-9-16)24(29-22)28-21-13-10-17-6-4-5-7-19(17)21/h4-9,11-12,14,21H,10,13,15H2,1-3H3,(H,28,29)/t21-/m0/s1

Standard InChI Key:  CCGFRMXUSFNZLI-NRFANRHFSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   17.9328  -23.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9328  -24.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6381  -24.4291    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6381  -22.7864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3475  -23.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3475  -24.0211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1254  -24.2726    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6079  -23.6102    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.1255  -22.9478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6381  -21.9651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2230  -22.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3771  -25.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2257  -24.4342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2269  -25.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8304  -25.6538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1765  -25.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5866  -25.8323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5174  -23.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8109  -22.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8242  -24.4383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5264  -24.0244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1095  -24.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1014  -23.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4055  -24.4485    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.6416  -26.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8928  -25.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8243  -26.5079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5741  -25.7338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7802  -25.5648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2358  -26.1690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4907  -26.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2840  -27.1101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  4 10  2  0
  1 11  1  0
  7 12  1  0
  2 13  1  0
 14 13  1  1
 12 15  1  0
 12 16  1  0
 12 17  1  0
 11 18  1  0
 18 19  2  0
 19 23  1  0
 22 20  1  0
 20 21  2  0
 21 18  1  0
 22 23  2  0
 22 24  1  0
 14 28  1  0
 27 25  1  0
 25 26  1  0
 26 14  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4649481

    ---

Associated Targets(Human)

PDE1C Tclin Phosphodiesterase 1C (228 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.52Molecular Weight (Monoisotopic): 431.2121AlogP: 4.63#Rotatable Bonds: 4
Polar Surface Area: 64.74Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.50CX LogP: 4.71CX LogD: 4.71
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: -1.48

References

1. Wu Y, Tian YJ, Le ML, Zhang SR, Zhang C, Huang MX, Jiang MY, Zhang B, Luo HB..  (2020)  Discovery of Novel Selective and Orally Bioavailable Phosphodiesterase-1 Inhibitors for the Efficient Treatment of Idiopathic Pulmonary Fibrosis.,  63  (14): [PMID:32603117] [10.1021/acs.jmedchem.0c00711]

Source