3-Phenyl-acrylic acid (1S,2R,7S,8R,10R)-8-(1-acetyl-piperidin-4-yl)-10-(2-hydroxy-acetoxy)-1,5-dimethyl-11-oxa-tricyclo[6.2.1.0(2,6)]undec-5-en-7-yl ester

ID: ALA4649530

PubChem CID: 137401711

Max Phase: Preclinical

Molecular Formula: C30H37NO7

Molecular Weight: 523.63

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCC([C@@]23C[C@@H](OC(=O)CO)[C@@](C)(O2)[C@@H]2CCC(C)=C2[C@@H]3OC(=O)/C=C/c2ccccc2)CC1

Standard InChI:  InChI=1S/C30H37NO7/c1-19-9-11-23-27(19)28(37-25(34)12-10-21-7-5-4-6-8-21)30(22-13-15-31(16-14-22)20(2)33)17-24(29(23,3)38-30)36-26(35)18-32/h4-8,10,12,22-24,28,32H,9,11,13-18H2,1-3H3/b12-10+/t23-,24-,28+,29+,30-/m1/s1

Standard InChI Key:  YZZRKVMSYAMVRQ-PDXYHNIYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   22.9928   -6.4076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8024   -7.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3043   -7.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1193   -7.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6361   -7.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4619   -6.4274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7255   -6.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6302   -5.2618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8355   -5.1049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4398   -5.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6276   -5.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3002   -5.4949    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.5416   -7.0334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0593   -5.8810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4168   -7.4340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.9915   -6.8593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7765   -7.0695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.3470   -6.4948    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.7813   -6.0744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.5145   -8.6305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2994   -8.8365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5055   -9.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9349  -10.1961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.1500   -9.9860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9398   -9.2011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1451  -10.9769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9259  -11.1871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5704  -11.5516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.0175   -7.4141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8073   -8.1949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3820   -8.7696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0265   -8.4051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8163   -9.1900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0314   -9.4002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8209  -10.1810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0391  -10.3892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4683   -9.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6748   -9.0385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4573   -8.8220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  4  1  0
  6  5  1  0
  7  6  1  0
  1  7  1  0
  7  8  1  0
  9  8  1  0
 10  9  1  0
  1 10  2  0
 10 11  1  0
  7 12  1  6
  6 13  1  0
  3 13  1  0
  6 14  1  6
  5 15  1  6
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  2  0
  3 20  1  6
 21 20  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 20 25  1  0
 23 26  1  0
 26 27  1  0
 26 28  2  0
  2 29  1  1
 29 30  1  0
 30 31  2  0
 30 32  1  0
 32 33  2  0
 33 34  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 38 37  1  0
 39 38  2  0
 34 39  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4649530

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 523.63

Molecular Weight (Monoisotopic): 523.2570

AlogP: 3.43

#Rotatable Bonds: 6

Polar Surface Area: 102.37

Molecular Species: NEUTRAL

HBA: 7

HBD: 1

#RO5 Violations: 1

HBA (Lipinski): 8

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 13.13

CX Basic pKa: ┄

CX LogP: 2.48

CX LogD: 2.48

Aromatic Rings: 1

Heavy Atoms: 38

QED Weighted: 0.35

Np Likeness Score: 1.44

References

1. Wu Z, Suppo JS, Tumova S, Strope J, Bravo F, Moy M, Weinstein ES, Peer CJ, Figg WD, Chain WJ, Echavarren AM, Beech DJ, Beutler JA..  (2020)  Bridgehead Modifications of Englerin A Reduce TRPC4 Activity and Intravenous Toxicity but not Cell Growth Inhibition.,  11  (9): [PMID:32944138] [10.1021/acsmedchemlett.0c00186]

Source

Source(1):

• Scientific Literature