The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-methyl-N-(1-(2-(phenylamino)nicotinoyl)piperidin-4-yl)-2-trifluoromethyl-4-fluoro-benzamide ID: ALA4649551
PubChem CID: 156021963
Max Phase: Preclinical
Molecular Formula: C26H24F4N4O2
Molecular Weight: 500.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C(=O)c1ccc(F)cc1C(F)(F)F)C1CCN(C(=O)c2cccnc2Nc2ccccc2)CC1
Standard InChI: InChI=1S/C26H24F4N4O2/c1-33(24(35)20-10-9-17(27)16-22(20)26(28,29)30)19-11-14-34(15-12-19)25(36)21-8-5-13-31-23(21)32-18-6-3-2-4-7-18/h2-10,13,16,19H,11-12,14-15H2,1H3,(H,31,32)
Standard InChI Key: QDSKINKQTZSEKY-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
31.3825 -21.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2063 -21.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6195 -20.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2059 -19.5948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3788 -19.5948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9735 -20.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1479 -20.3105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7350 -19.6027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1447 -18.8931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7325 -18.1834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9101 -18.1834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5017 -18.9031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9162 -19.6027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9719 -21.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3828 -22.4469 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9704 -23.1612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3778 -23.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2039 -23.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6207 -23.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2076 -22.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6162 -24.5956 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1988 -25.3097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6112 -26.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1906 -26.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6022 -27.4554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4288 -27.4554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8419 -26.7363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4320 -26.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8379 -28.1719 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.3650 -26.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9583 -26.0170 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.9501 -27.4440 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.5361 -26.7308 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.3732 -25.3097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.4418 -24.5956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1504 -21.7315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
1 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
15 20 1 0
18 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
24 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
22 34 2 0
21 35 1 0
14 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.50Molecular Weight (Monoisotopic): 500.1835AlogP: 5.36#Rotatable Bonds: 5Polar Surface Area: 65.54Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.10CX LogP: 5.52CX LogD: 5.52Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.48Np Likeness Score: -1.75
References 1. Ji D, Zhang W, Xu Y, Zhang JJ.. (2020) Design, synthesis and biological evaluation of anthranilamide derivatives as potent SMO inhibitors., 28 (6): [PMID:32063403 ] [10.1016/j.bmc.2020.115354 ]