The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Pentyl ((5S)-5-(((4-amino-5-fluoropyrimidin-2-yl)oxy)methyl)-2-oxido-1,4,2-dioxaphosphinan-2-yl)-L-valinate ID: ALA4649652
PubChem CID: 156022189
Max Phase: Preclinical
Molecular Formula: C18H30FN4O6P
Molecular Weight: 448.43
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCOC(=O)[C@@H](NP1(=O)CO[C@@H](COc2ncc(F)c(N)n2)CO1)C(C)C
Standard InChI: InChI=1S/C18H30FN4O6P/c1-4-5-6-7-26-17(24)15(12(2)3)23-30(25)11-28-13(10-29-30)9-27-18-21-8-14(19)16(20)22-18/h8,12-13,15H,4-7,9-11H2,1-3H3,(H,23,25)(H2,20,21,22)/t13-,15-,30?/m0/s1
Standard InChI Key: VYGWOVAYVUFJLS-IVQJTNLTSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
18.9074 -12.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9063 -13.8194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6211 -14.2323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.3376 -13.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3348 -12.9884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6194 -12.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6168 -11.7542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0528 -14.2303 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0540 -15.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7692 -15.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7664 -16.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4775 -16.6998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1938 -16.2898 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
23.1944 -15.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4788 -15.0479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.9074 -16.7039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1881 -17.1130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6228 -16.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3363 -16.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0517 -16.2961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.3345 -17.5320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7653 -16.7101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4807 -16.2992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1943 -16.7133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9097 -16.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6232 -16.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6246 -15.4678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3400 -15.0569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9110 -15.0538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1928 -12.5796 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
4 8 1 0
8 9 1 0
10 9 1 6
10 11 1 0
10 15 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
13 16 1 0
13 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
18 27 1 1
27 28 1 0
27 29 1 0
1 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.43Molecular Weight (Monoisotopic): 448.1887AlogP: 2.49#Rotatable Bonds: 11Polar Surface Area: 134.89Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.54CX Basic pKa: 3.27CX LogP: 2.23CX LogD: 2.23Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.30Np Likeness Score: -0.32
References 1. Luo M, Groaz E, Snoeck R, Andrei G, Herdewijn P.. (2020) Amidate Prodrugs of O -2-Alkylated Pyrimidine Acyclic Nucleosides Display Potent Anti-Herpesvirus Activity., 11 (7): [PMID:32676147 ] [10.1021/acsmedchemlett.0c00090 ]