O-((41S,13aS)-13a-ethyl-2,3,41,5,6,13a-hexahydro-1H-indolo[3,2,1-de]pyrido[3,2,1-ij][1,5]naphthyridin-12-yl)methyl p-tolylcarbamothioate

ID: ALA4649694

PubChem CID: 156022232

Max Phase: Preclinical

Molecular Formula: C28H31N3OS

Molecular Weight: 457.64

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@@]12C=C(COC(=S)Nc3ccc(C)cc3)n3c4c(c5ccccc53)CCN(CCC1)[C@H]42

Standard InChI:  InChI=1S/C28H31N3OS/c1-3-28-14-6-15-30-16-13-23-22-7-4-5-8-24(22)31(25(23)26(28)30)21(17-28)18-32-27(33)29-20-11-9-19(2)10-12-20/h4-5,7-12,17,26H,3,6,13-16,18H2,1-2H3,(H,29,33)/t26-,28+/m1/s1

Standard InChI Key:  UFGKTUSMOVJXPS-IAPPQJPRSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    9.9448   -2.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3553   -2.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6500   -2.4302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9448   -3.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2458   -4.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9511   -5.2833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6461   -4.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6563   -4.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3596   -5.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0572   -4.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0470   -4.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3392   -3.6483    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2464   -4.0689    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5386   -5.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8304   -4.8804    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6918   -3.2637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1636   -2.6008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8253   -1.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0155   -1.7867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5452   -2.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8860   -3.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6400   -3.2440    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.6482   -5.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3519   -6.1070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1232   -5.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4150   -4.8820    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1241   -6.1070    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.7078   -5.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0002   -4.8810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2934   -5.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2939   -6.1078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0071   -6.5154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7109   -6.1044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5872   -6.5181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  4  2  0
  1  3  1  0
 12  2  1  0
  2  3  1  0
  7  4  1  0
 13  5  1  0
  5  6  2  0
  6  8  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 13  4  1  0
  1 17  1  0
 16 13  1  0
  5 14  1  0
 14 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  7 22  1  6
  8 23  1  6
 23 24  1  0
 15 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4649694

    ---

Associated Targets(Human)

PDE1A Tclin Phosphodiesterase 1A (251 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.64Molecular Weight (Monoisotopic): 457.2188AlogP: 6.31#Rotatable Bonds: 4
Polar Surface Area: 29.43Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.56CX Basic pKa: 7.23CX LogP: 5.86CX LogD: 5.79
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: 0.15

References

1. Pan BW, Shi Y, Li WC, Wang Q, Pan M, Wu Q, Fu HZ..  (2020)  Synthesis and biological evaluation of Vinpocetine derivatives.,  30  (2): [PMID:31859156] [10.1016/j.bmcl.2019.05.052]

Source