The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ETAVOPIVAT ID: ALA4650332
Cas Number: 2245053-57-8
PubChem CID: 135338378
Product Number: E610197, Order Now?
Max Phase: Phase
Molecular Formula: C22H23N3O6S
Molecular Weight: 457.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Synonyms: Etavopivat | Ft-4202 | FT-4202
Canonical SMILES: O=C([C@H](CO)c1ccccc1)N1CC2=C(C1)CN(S(=O)(=O)c1cnc3c(c1)OCCO3)C2
Standard InChI: InChI=1S/C22H23N3O6S/c26-14-19(15-4-2-1-3-5-15)22(27)24-10-16-12-25(13-17(16)11-24)32(28,29)18-8-20-21(23-9-18)31-7-6-30-20/h1-5,8-9,19,26H,6-7,10-14H2/t19-/m1/s1
Standard InChI Key: KZFFYEPYCVDOGE-LJQANCHMSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-4.9891 1.0377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7036 0.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7036 -0.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9891 -0.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2746 -0.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2746 0.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7036 2.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4180 1.8627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9891 1.8627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2746 2.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5602 1.0377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5602 1.8627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7756 0.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2906 1.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7755 2.1176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2907 0.1153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5061 0.3702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5060 1.1952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1146 -0.7619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5636 -1.4540 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1886 -2.1889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3647 -2.2317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9158 -1.5395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -0.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6376 -2.8811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2626 -3.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4387 -3.6587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9898 -2.9666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2746 3.1002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8418 -0.1125 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.3568 0.5549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1744 -0.5974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
7 8 1 0
7 9 1 0
9 1 1 1
11 12 1 0
10 12 1 0
10 9 1 0
13 14 2 0
14 15 1 0
11 13 1 0
12 15 1 0
16 17 1 0
17 18 1 0
13 16 1 0
14 18 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
19 24 1 0
25 26 1 0
26 27 1 0
27 28 1 0
21 25 1 0
28 22 1 0
10 29 2 0
17 30 1 0
30 24 1 0
30 31 2 0
30 32 2 0
M END
Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: YesAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.51Molecular Weight (Monoisotopic): 457.1308AlogP: 0.77#Rotatable Bonds: 5Polar Surface Area: 109.27Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: -0.25CX LogD: -0.25Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.66Np Likeness Score: -0.75
References 1. Unpublished dataset, 2. (2020) Inhibiting ubiquitin specific peptidase 9x, 3. USP Dictionary of USAN and International Names (2010 edition) and USAN registrations 2007-date,