ETAVOPIVAT

ID: ALA4650332

Cas Number: 2245053-57-8

PubChem CID: 135338378

Product Number: E610197, Order Now?

Max Phase: Phase

Molecular Formula: C22H23N3O6S

Molecular Weight: 457.51

Molecule Type: Small molecule

In stock!

Associated Items:

Names and Identifiers

Synonyms: Etavopivat | Ft-4202 | FT-4202

Canonical SMILES:  O=C([C@H](CO)c1ccccc1)N1CC2=C(C1)CN(S(=O)(=O)c1cnc3c(c1)OCCO3)C2

Standard InChI:  InChI=1S/C22H23N3O6S/c26-14-19(15-4-2-1-3-5-15)22(27)24-10-16-12-25(13-17(16)11-24)32(28,29)18-8-20-21(23-9-18)31-7-6-30-20/h1-5,8-9,19,26H,6-7,10-14H2/t19-/m1/s1

Standard InChI Key:  KZFFYEPYCVDOGE-LJQANCHMSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   -4.9891    1.0377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7036    0.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7036   -0.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9891   -0.6124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2746   -0.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2746    0.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7036    2.2752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4180    1.8627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9891    1.8627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2746    2.2752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5602    1.0377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5602    1.8627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7756    0.7827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2906    1.4502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7755    2.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2907    0.1153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5061    0.3702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5060    1.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1146   -0.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5636   -1.4540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1886   -2.1889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3647   -2.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9158   -1.5395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2907   -0.8046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6376   -2.8811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2626   -3.6160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4387   -3.6587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9898   -2.9666    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2746    3.1002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8418   -0.1125    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3568    0.5549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1744   -0.5974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  2  0
  7  8  1  0
  7  9  1  0
  9  1  1  1
 11 12  1  0
 10 12  1  0
 10  9  1  0
 13 14  2  0
 14 15  1  0
 11 13  1  0
 12 15  1  0
 16 17  1  0
 17 18  1  0
 13 16  1  0
 14 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 19 24  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 21 25  1  0
 28 22  1  0
 10 29  2  0
 17 30  1  0
 30 24  1  0
 30 31  2  0
 30 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4650332

    etavopivat

Associated Targets(Human)

USP9X Tbio Probable ubiquitin carboxyl-terminal hydrolase FAF-X (500 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: YesAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.51Molecular Weight (Monoisotopic): 457.1308AlogP: 0.77#Rotatable Bonds: 5
Polar Surface Area: 109.27Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: -0.25CX LogD: -0.25
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.66Np Likeness Score: -0.75

References

1. Unpublished dataset, 
2.  (2020)  Inhibiting ubiquitin specific peptidase 9x, 
3. USP Dictionary of USAN and International Names (2010 edition) and USAN registrations 2007-date,