serratamolide B

ID: ALA465041

PubChem CID: 44567586

Max Phase: Preclinical

Molecular Formula: C28H48N2O8

Molecular Weight: 540.70

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCC/C=C\C[C@@H]1CC(=O)N[C@@H](CO)C(=O)O[C@H](CCCCCCC)CC(=O)N[C@@H](CO)C(=O)O1

Standard InChI:  InChI=1S/C28H48N2O8/c1-3-5-7-9-10-12-14-16-22-18-26(34)30-23(19-31)27(35)37-21(15-13-11-8-6-4-2)17-25(33)29-24(20-32)28(36)38-22/h12,14,21-24,31-32H,3-11,13,15-20H2,1-2H3,(H,29,33)(H,30,34)/b14-12-/t21-,22-,23+,24+/m1/s1

Standard InChI Key:  YMOFMWFDYPVUFF-JYGRAXMSSA-N

Molfile:  

     RDKit          2D

 38 38  0  0  0  0  0  0  0  0999 V2000
   12.0677   -4.1701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8004   -3.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4952   -4.2358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2278   -3.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9225   -4.3017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6551   -3.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3499   -4.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0826   -3.9884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5817   -4.9601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8960   -5.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2969   -5.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0381   -6.2564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2219   -6.1900    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2923   -6.6208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9970   -6.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3351   -7.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0363   -7.3121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1140   -7.7407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2937   -7.6771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0453   -8.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4436   -8.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7661   -8.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6706   -7.9427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1334   -5.1295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6656   -6.0039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2085   -8.7920    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5815   -6.2020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8635   -6.6081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7468   -7.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4652   -7.3258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3150   -8.9374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0297   -4.9943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6175   -8.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8872   -8.8804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1898   -8.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4595   -8.8235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7620   -8.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0317   -8.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  7  1  0
  7  8  1  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
 11 13  1  0
 14 27  1  6
 12 14  1  0
 27 28  1  0
 13 15  1  0
 17 29  1  6
 14 16  1  0
 29 30  1  0
 15 17  1  0
 20 31  1  1
 16 18  1  0
 11 32  1  1
 17 19  1  0
 20 18  1  0
 19 21  1  0
 20 22  1  0
 21 22  1  0
 31 33  1  0
 16 23  2  0
 33 34  1  0
  9 10  1  0
 34 35  1  0
 10 24  2  0
 35 36  1  0
  9 11  1  0
 36 37  1  0
 15 25  2  0
 10 12  1  0
 21 26  2  0
 37 38  1  0
 32  1  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Mycolicibacterium diernhoferi (48 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycolicibacterium phlei (631 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycolicibacterium smegmatis (8003 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 540.70Molecular Weight (Monoisotopic): 540.3411AlogP: 2.84#Rotatable Bonds: 15
Polar Surface Area: 151.26Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.53CX Basic pKa: CX LogP: 3.41CX LogD: 3.41
Aromatic Rings: Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: 1.55

References

1. Dwivedi D, Jansen R, Molinari G, Nimtz M, Johri BN, Wray V..  (2008)  Antimycobacterial serratamolides and diacyl peptoglucosamine derivatives from Serratia sp.,  71  (4): [PMID:18303848] [10.1021/np7007126]

Source