The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
serratamolide B ID: ALA465041
PubChem CID: 44567586
Max Phase: Preclinical
Molecular Formula: C28H48N2O8
Molecular Weight: 540.70
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCC/C=C\C[C@@H]1CC(=O)N[C@@H](CO)C(=O)O[C@H](CCCCCCC)CC(=O)N[C@@H](CO)C(=O)O1
Standard InChI: InChI=1S/C28H48N2O8/c1-3-5-7-9-10-12-14-16-22-18-26(34)30-23(19-31)27(35)37-21(15-13-11-8-6-4-2)17-25(33)29-24(20-32)28(36)38-22/h12,14,21-24,31-32H,3-11,13,15-20H2,1-2H3,(H,29,33)(H,30,34)/b14-12-/t21-,22-,23+,24+/m1/s1
Standard InChI Key: YMOFMWFDYPVUFF-JYGRAXMSSA-N
Molfile:
RDKit 2D
38 38 0 0 0 0 0 0 0 0999 V2000
12.0677 -4.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8004 -3.7909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4952 -4.2358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2278 -3.8568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9225 -4.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6551 -3.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3499 -4.3675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0826 -3.9884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5817 -4.9601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8960 -5.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2969 -5.3735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0381 -6.2564 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2219 -6.1900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2923 -6.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9970 -6.4873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3351 -7.4536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0363 -7.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1140 -7.7407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2937 -7.6771 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0453 -8.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4436 -8.4829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7661 -8.9654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6706 -7.9427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1334 -5.1295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6656 -6.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2085 -8.7920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5815 -6.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8635 -6.6081 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7468 -7.7314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4652 -7.3258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3150 -8.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0297 -4.9943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6175 -8.4967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8872 -8.8804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1898 -8.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4595 -8.8235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7620 -8.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0317 -8.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6 7 1 0
7 8 1 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
11 13 1 0
14 27 1 6
12 14 1 0
27 28 1 0
13 15 1 0
17 29 1 6
14 16 1 0
29 30 1 0
15 17 1 0
20 31 1 1
16 18 1 0
11 32 1 1
17 19 1 0
20 18 1 0
19 21 1 0
20 22 1 0
21 22 1 0
31 33 1 0
16 23 2 0
33 34 1 0
9 10 1 0
34 35 1 0
10 24 2 0
35 36 1 0
9 11 1 0
36 37 1 0
15 25 2 0
10 12 1 0
21 26 2 0
37 38 1 0
32 1 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.70Molecular Weight (Monoisotopic): 540.3411AlogP: 2.84#Rotatable Bonds: 15Polar Surface Area: 151.26Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.53CX Basic pKa: ┄CX LogP: 3.41CX LogD: 3.41Aromatic Rings: ┄Heavy Atoms: 38QED Weighted: 0.14Np Likeness Score: 1.55
References 1. Dwivedi D, Jansen R, Molinari G, Nimtz M, Johri BN, Wray V.. (2008) Antimycobacterial serratamolides and diacyl peptoglucosamine derivatives from Serratia sp., 71 (4): [PMID:18303848 ] [10.1021/np7007126 ]