12beta-hydroxy-3-oxomultiflora-8-en-29-oic acid

ID: ALA465067

PubChem CID: 11048975

Max Phase: Preclinical

Molecular Formula: C30H46O4

Molecular Weight: 470.69

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: Sandorinic acid C | SANDORINIC ACID C|CHEMBL465067|(2R,4aS,6aR,8aR,12aS,14R,14aS,14bR)-14-hydroxy-2,4a,6a,9,9,12a,14a-heptamethyl-10-oxo-3,4,5,6,7,8,8a,11,12,13,14,14b-dodecahydro-1H-picene-2-carboxylic acid

Canonical SMILES:  CC1(C)C(=O)CC[C@]2(C)C3=C(CC[C@@H]12)[C@@]1(C)CC[C@@]2(C)CC[C@@](C)(C(=O)O)C[C@H]2[C@]1(C)[C@H](O)C3

Standard InChI:  InChI=1S/C30H46O4/c1-25(2)20-9-8-18-19(28(20,5)11-10-22(25)31)16-23(32)30(7)21-17-27(4,24(33)34)13-12-26(21,3)14-15-29(18,30)6/h20-21,23,32H,8-17H2,1-7H3,(H,33,34)/t20-,21+,23+,26+,27+,28+,29+,30+/m0/s1

Standard InChI Key:  ARUDPAROWGJVLG-FUPYXVGYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   11.0460   -2.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0460   -1.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7581   -0.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7581   -2.4942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2282   -3.1278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2881   -3.1278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4704   -2.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1868   -2.4942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9032   -2.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9032   -1.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6154   -0.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6154   -1.6693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3318   -1.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0440   -0.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0440   -0.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7605   -0.4297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7605    0.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7605    1.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0440    1.6306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5740    2.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5141    2.2641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3318    1.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3318    0.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3610   -0.4289    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.6154   -0.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6154    0.8056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9032    0.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1868   -0.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1868   -0.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4704   -1.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4704   -0.4297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9042    1.2202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4657   -2.9019    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.3306   -2.4936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7927    3.0355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6986    2.1207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  1
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  1
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  6
 19 22  1  0
 22 23  1  0
 23 24  1  1
 15 23  1  0
 23 25  1  0
 11 25  1  0
 25 26  1  6
 25 27  1  0
 27 28  1  0
 28 29  1  0
 10 29  2  0
 29 30  1  0
  3 30  1  0
  7 30  1  0
 30 31  1  1
 27 32  1  1
  1  2  1  0
  7 33  1  6
  2  3  1  0
  1 34  2  0
  1  4  1  0
  4  5  1  0
 21 35  1  0
 21 36  2  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

P388/S (109 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
P388 (20296 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.69Molecular Weight (Monoisotopic): 470.3396AlogP: 6.56#Rotatable Bonds: 1
Polar Surface Area: 74.60Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.51CX Basic pKa: CX LogP: 5.88CX LogD: 3.09
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: 3.18

References

1. Tanaka T, Koyano T, Kowithayakorn T, Fujimoto H, Okuyama E, Hayashi M, Komiyama K, Ishibashi M..  (2001)  New multiflorane-type triterpenoid acids from Sandoricum indicum.,  64  (9): [PMID:11575968] [10.1021/np010196w]

Source