(2R,3S,28S,29R)-2,29-diaminotriacontane-3,28-diol

ID: ALA465242

PubChem CID: 44570362

Max Phase: Preclinical

Molecular Formula: C30H64N2O2

Molecular Weight: 484.85

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H](N)[C@@H](O)CCCCCCCCCCCCCCCCCCCCCCCC[C@H](O)[C@@H](C)N

Standard InChI:  InChI=1S/C30H64N2O2/c1-27(31)29(33)25-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-26-30(34)28(2)32/h27-30,33-34H,3-26,31-32H2,1-2H3/t27-,28-,29+,30+/m1/s1

Standard InChI Key:  SUOKTYFGZNMWLR-XAZDILKDSA-N

Molfile:  

     RDKit          2D

 34 33  0  0  0  0  0  0  0  0999 V2000
   -2.3696   -4.3329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6503   -3.9112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9403   -4.3148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2263   -3.8931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4911   -4.2967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2049   -3.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9226   -4.2786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6362   -3.8569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3538   -4.2605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0678   -3.8388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7851   -4.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4990   -3.8207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2167   -4.2243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9303   -3.8026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6479   -4.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3617   -3.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0792   -4.1882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7931   -3.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5108   -4.1701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2268   -3.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9445   -4.1551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6584   -3.7331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3760   -4.1366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0899   -3.7146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0829   -2.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8093   -4.1214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3634   -2.4845    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7967   -2.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0854   -3.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0949   -3.1044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8164   -2.6945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8197   -1.8732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5207   -3.1189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3761   -2.6836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
 17 18  1  0
  4  5  1  0
 18 19  1  0
  9 10  1  0
 19 20  1  0
  2  3  1  0
 20 21  1  0
 10 11  1  0
 21 22  1  0
  5  6  1  0
 22 23  1  0
 11 12  1  0
 23 24  1  0
  1  2  1  0
 24 25  1  0
 12 13  1  0
 24 26  1  1
  6  7  1  0
 25 27  1  6
 13 14  1  0
 25 28  1  0
  3  4  1  0
  1 29  1  0
 14 15  1  0
 29 30  1  0
  7  8  1  0
 30 31  1  0
 15 16  1  0
 31 32  1  0
 31 33  1  6
 16 17  1  0
 30 34  1  1
M  END

Alternative Forms

Associated Targets(Human)

UBE2V1 Tbio Ubiquitin-conjugating enzyme E2 N/Ubiquitin-conjugating enzyme E2 variant 1 (12 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.85Molecular Weight (Monoisotopic): 484.4968AlogP: 7.77#Rotatable Bonds: 27
Polar Surface Area: 92.50Molecular Species: BASEHBA: 4HBD: 4
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 6#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.13CX LogP: 8.51CX LogD: 3.83
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.09Np Likeness Score: 0.52

References

1. Tsukamoto S, Takeuchi T, Rotinsulu H, Mangindaan RE, van Soest RW, Ukai K, Kobayashi H, Namikoshi M, Ohta T, Yokosawa H..  (2008)  Leucettamol A: a new inhibitor of Ubc13-Uev1A interaction isolated from a marine sponge, Leucetta aff. microrhaphis.,  18  (24): [PMID:19006668] [10.1016/j.bmcl.2008.10.110]

Source