The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
leucettamol A ID: ALA465243
Cas Number: 151124-32-2
PubChem CID: 44570361
Max Phase: Preclinical
Molecular Formula: C30H52N2O2
Molecular Weight: 472.76
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H](N)[C@@H](O)C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC[C@H](O)[C@@H](C)N
Standard InChI: InChI=1S/C30H52N2O2/c1-27(31)29(33)25-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-26-30(34)28(2)32/h3,5-6,8-9,11-12,14-15,17,21,23,27-30,33-34H,4,7,10,13,16,18-20,22,24-26,31-32H2,1-2H3/b5-3-,8-6-,11-9-,14-12-,17-15-,23-21-/t27-,28-,29+,30+/m1/s1
Standard InChI Key: CXFKWMQQNSTRAS-WGELTRNKSA-N
Molfile:
RDKit 2D
34 33 0 0 0 0 0 0 0 0999 V2000
-2.1583 1.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3333 1.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6208 1.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0959 1.3248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9208 1.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6333 1.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3501 1.3331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1750 1.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8875 1.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6043 1.3415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4292 1.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1417 1.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8584 1.3498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6833 1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3958 1.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1083 1.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9333 1.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6458 1.7708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3626 1.3623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0748 1.7788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7915 1.3703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5037 1.7867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2204 1.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9326 1.7947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6493 1.3862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9280 2.6197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6539 0.5612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3615 1.8026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8750 1.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5889 1.3157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3039 1.7273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0179 1.3138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3050 2.5523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5878 0.4907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8 9 1 0
17 18 1 0
4 5 2 0
18 19 1 0
9 10 1 0
19 20 1 0
2 3 1 0
20 21 1 0
10 11 2 0
21 22 1 0
5 6 1 0
22 23 1 0
11 12 1 0
23 24 1 0
1 2 2 0
24 25 1 0
12 13 1 0
24 26 1 6
6 7 1 0
25 27 1 1
13 14 2 0
25 28 1 0
3 4 1 0
1 29 1 0
14 15 1 0
29 30 1 0
7 8 2 0
30 31 1 0
15 16 1 0
31 32 1 0
31 33 1 1
16 17 2 0
30 34 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.76Molecular Weight (Monoisotopic): 472.4029AlogP: 6.42#Rotatable Bonds: 21Polar Surface Area: 92.50Molecular Species: BASEHBA: 4HBD: 4#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.13CX LogP: 6.34CX LogD: 1.67Aromatic Rings: ┄Heavy Atoms: 34QED Weighted: 0.11Np Likeness Score: 1.29
References 1. Tsukamoto S, Takeuchi T, Rotinsulu H, Mangindaan RE, van Soest RW, Ukai K, Kobayashi H, Namikoshi M, Ohta T, Yokosawa H.. (2008) Leucettamol A: a new inhibitor of Ubc13-Uev1A interaction isolated from a marine sponge, Leucetta aff. microrhaphis., 18 (24): [PMID:19006668 ] [10.1016/j.bmcl.2008.10.110 ] 2. Ushiyama S, Umaoka H, Kato H, Suwa Y, Morioka H, Rotinsulu H, Losung F, Mangindaan RE, de Voogd NJ, Yokosawa H, Tsukamoto S.. (2012) Manadosterols A and B, sulfonated sterol dimers inhibiting the Ubc13-Uev1A interaction, isolated from the marine sponge Lissodendryx fibrosa., 75 (8): [PMID:22873794 ] [10.1021/np300352u ]