5'-Hydroxymethyl-5-[butyl-3-en-1-yn]-2,2'-bithiophene isovaleroxy ester

ID: ALA465391

PubChem CID: 10711521

Max Phase: Preclinical

Molecular Formula: C18H18O2S2

Molecular Weight: 330.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC#Cc1ccc(-c2ccc(COC(=O)CC(C)C)s2)s1

Standard InChI:  InChI=1S/C18H18O2S2/c1-4-5-6-14-7-9-16(21-14)17-10-8-15(22-17)12-20-18(19)11-13(2)3/h4,7-10,13H,1,11-12H2,2-3H3

Standard InChI Key:  ABERUZRGTVCXIS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   13.6331    0.5435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3010    0.0622    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.9650    0.5490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7071    1.3310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8838    1.3272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5538    1.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7288    1.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4698    0.5501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1349    0.0617    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.8047    0.5433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6839    0.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7507    0.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5339    0.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3197   -0.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4948   -1.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0737    0.8543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2877    0.6033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6775    1.1585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1121   -0.2028    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8531    1.9646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2428    2.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6390    2.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  2  0
  8 11  1  0
  6  7  1  0
  3 12  1  0
  1  2  1  0
 12 13  3  0
 13 14  1  0
  2  3  1  0
 14 15  2  0
  3  4  2  0
 11 16  1  0
  4  5  1  0
 16 17  1  0
  7  8  2  0
 17 18  1  0
  8  9  1  0
 17 19  2  0
  9 10  1  0
 18 20  1  0
 10  6  2  0
 20 21  1  0
 10  1  1  0
 20 22  1  0
M  END

Associated Targets(non-human)

Epidermophyton floccosum (561 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Pleurotus ostreatus (29 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 330.47Molecular Weight (Monoisotopic): 330.0748AlogP: 5.10#Rotatable Bonds: 5
Polar Surface Area: 26.30Molecular Species: HBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.67CX LogD: 5.67
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.56Np Likeness Score: 0.63

References

1. Ahmad VU, Alam N..  (1995)  New antifungal bithienylacetylenes from Blumea obliqua.,  58  (9): [PMID:7494149] [10.1021/np50123a014]

Source