{3-[4-((3R,5S)-3,5-Dimethyl-piperazin-1-ylmethyl)-phenyl]-pyridin-2-yl}-[4-(4-fluoro-benzyl)-piperidin-1-yl]-methanone

ID: ALA465925

PubChem CID: 11993730

Max Phase: Preclinical

Molecular Formula: C31H37FN4O

Molecular Weight: 500.66

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@@H]1CN(Cc2ccc(-c3cccnc3C(=O)N3CCC(Cc4ccc(F)cc4)CC3)cc2)C[C@H](C)N1

Standard InChI:  InChI=1S/C31H37FN4O/c1-22-19-35(20-23(2)34-22)21-26-5-9-27(10-6-26)29-4-3-15-33-30(29)31(37)36-16-13-25(14-17-36)18-24-7-11-28(32)12-8-24/h3-12,15,22-23,25,34H,13-14,16-21H2,1-2H3/t22-,23+

Standard InChI Key:  RLWXMWFCYVZNBY-ZRZAMGCNSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    9.7973    0.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7960   -0.3784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5090   -0.7913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2283   -0.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2252    0.4532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5070    0.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9424   -0.7883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9417   -1.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6557   -2.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3708   -1.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3674   -0.7838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6529   -0.3757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6498    0.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3628    0.8642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0826    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0818    1.6860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7962    2.0994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7975    2.9209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0845    3.3365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3687    2.9247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3657    2.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5132    3.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6552    3.3391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9339    0.8591    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0756    0.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7864    0.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7876    1.6878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0718    2.0998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3547    1.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5021    2.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2165    1.6876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2126    0.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9261    0.4523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6417    0.8648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6391    1.6941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9250    2.1028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3566    0.4532    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  4  5  1  0
  9 10  2  0
  2  3  1  0
 16 21  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 10 11  1  0
 18 22  1  1
  5  6  2  0
 20 23  1  1
 11 12  2  0
 13 24  2  0
 14 25  1  0
 12  7  1  0
  4  7  1  0
  6  1  1  0
 12 13  1  0
  1  2  2  0
 14 29  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 13 14  1  0
 27 30  1  0
  3  4  2  0
 30 31  1  0
  1 15  1  0
 31 32  2  0
  7  8  2  0
 32 33  1  0
 15 16  1  0
 33 34  2  0
 16 17  1  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
  8  9  1  0
 34 37  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA465925

   (3R,5S)-3,5-Dimethyl-1-({4-[2-({4-[(4-Fluorophenyl)methyl]piperidin-1-yl}carbonyl)pyridin-3-yl]phenyl}methyl)piperazine

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 500.66

Molecular Weight (Monoisotopic): 500.2951

AlogP: 5.16

#Rotatable Bonds: 6

Polar Surface Area: 48.47

Molecular Species: BASE

HBA: 4

HBD: 1

#RO5 Violations: 2

HBA (Lipinski): 5

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: 9.49

CX LogP: 5.18

CX LogD: 3.11

Aromatic Rings: 3

Heavy Atoms: 37

QED Weighted: 0.51

Np Likeness Score: -0.93

References

1. Westaway SM, Brown SL, Conway E, Heightman TD, Johnson CN, Lapsley K, Macdonald GJ, MacPherson DT, Mitchell DJ, Myatt JW, Seal JT, Stanway SJ, Stemp G, Thompson M, Celestini P, Colombo A, Consonni A, Gagliardi S, Riccaboni M, Ronzoni S, Briggs MA, Matthews KL, Stevens AJ, Bolton VJ, Boyfield I, Jarvie EM, Stratton SC, Sanger GJ..  (2008)  The discovery of biaryl carboxamides as novel small molecule agonists of the motilin receptor.,  18  (24): [PMID:19006669] [10.1016/j.bmcl.2008.10.072]

2. Toda N, Shida T, Takano R, Katagiri T, Hirouchi M, Abe M, Soma K, Nakagami Y, Yamazaki M..  (2022)  Discovery of DS-3801b, a non-macrolide GPR38 agonist with N-methylanilide structure.,  59  [PMID:35051575] [10.1016/j.bmcl.2022.128554]

Source

Source(1):

• Scientific Literature