N-[5-(4-Methoxyphenyl)pyridin-2-yl]benzamide

ID: ALA467971

PubChem CID: 24949559

Max Phase: Preclinical

Molecular Formula: C19H16N2O2

Molecular Weight: 304.35

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2ccc(NC(=O)c3ccccc3)nc2)cc1

Standard InChI:  InChI=1S/C19H16N2O2/c1-23-17-10-7-14(8-11-17)16-9-12-18(20-13-16)21-19(22)15-5-3-2-4-6-15/h2-13H,1H3,(H,20,21,22)

Standard InChI Key:  DTZTUPNDUJOKPM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    6.0916  -15.4390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0904  -16.2670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8059  -16.6803    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5230  -16.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5201  -15.4353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8041  -15.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2388  -16.6783    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9532  -16.2643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6690  -16.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6656  -17.5003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3805  -17.9119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0960  -17.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0921  -16.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3765  -16.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9519  -15.4386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3785  -15.0264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3796  -14.1996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6652  -13.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9493  -14.2001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9521  -15.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6670  -15.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2334  -13.7883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2321  -12.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  2  0
 11 12  2  0
  6  1  1  0
 12 13  1  0
  1  2  2  0
 13 14  2  0
 14  9  1  0
  4  7  1  0
  8 15  2  0
  3  4  2  0
  7  8  1  0
 16 17  2  0
 17 18  1  0
  8  9  1  0
 18 19  2  0
  4  5  1  0
 19 20  1  0
  9 10  2  0
 20 21  2  0
 21 16  1  0
  1 16  1  0
  2  3  1  0
 19 22  1  0
 10 11  1  0
 22 23  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Luciferase (58 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 304.35Molecular Weight (Monoisotopic): 304.1212AlogP: 4.01#Rotatable Bonds: 4
Polar Surface Area: 51.22Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.26CX LogP: 3.93CX LogD: 3.93
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.79Np Likeness Score: -1.17

References

1. Heitman LH, van Veldhoven JP, Zweemer AM, Ye K, Brussee J, IJzerman AP..  (2008)  False positives in a reporter gene assay: identification and synthesis of substituted N-pyridin-2-ylbenzamides as competitive inhibitors of firefly luciferase.,  51  (15): [PMID:18646744] [10.1021/jm8004509]

Source