2-Propyl-3-[2'-(1H-tetrazol-5-yl)-biphenyl-4-ylmethyl]-3,5-dihydro-imidazo[4,5-c]pyridin-4-one

ID: ALA46822

PubChem CID: 10093043

Max Phase: Preclinical

Molecular Formula: C23H21N7O

Molecular Weight: 411.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCc1nc2ccnc(O)c2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1

Standard InChI:  InChI=1S/C23H21N7O/c1-2-5-20-25-19-12-13-24-23(31)21(19)30(20)14-15-8-10-16(11-9-15)17-6-3-4-7-18(17)22-26-28-29-27-22/h3-4,6-13H,2,5,14H2,1H3,(H,24,31)(H,26,27,28,29)

Standard InChI Key:  JASVAUNATQDFDG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -2.6083    1.7375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0333    1.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0333    2.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6083    2.7125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9583    2.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4458   -0.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1833   -0.1292    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5833   -0.1792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4125   -0.6875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5208    1.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9583   -1.0792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9750   -1.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4208   -0.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5208    2.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9958    1.9250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1250    1.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9958    2.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3208   -0.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5208    1.0250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7583   -0.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7875    0.0458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1333    0.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5583    2.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6958    0.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6708    0.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0708   -1.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9500   -1.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8583    2.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6083   -2.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0458   -1.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4583    2.7458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  5  2  0
  5  1  1  0
  6 12  1  0
  7  8  2  0
  8  6  1  0
  9 11  1  0
 10  2  1  0
 11  6  2  0
 12 13  2  0
 13 18  1  0
 14  3  1  0
 15 10  2  0
 16  1  1  0
 17 15  1  0
 18 20  2  0
 19 10  1  0
 20 25  1  0
 21 24  2  0
 22 16  1  0
 23  5  1  0
 24 22  1  0
 25 22  2  0
 26 12  1  0
 27 13  1  0
 28 23  1  0
 29 30  1  0
 30 27  2  0
 31 28  1  0
  3  4  1  0
 21 18  1  0
 17 14  2  0
 26 29  2  0
  7  9  1  0
M  END

Associated Targets(Human)

AGTR1 Tclin Angiotensin II receptor (1039 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Agtr1b Angiotensin II receptor (AT-1) type-1 (1480 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 411.47Molecular Weight (Monoisotopic): 411.1808AlogP: 3.98#Rotatable Bonds: 6
Polar Surface Area: 105.40Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 5.85CX Basic pKa: 4.18CX LogP: 5.18CX LogD: 4.03
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: -1.10

References

1. Mederski WW, Dorsch D, Bokel HH, Beier N, Lues I, Schelling P..  (1994)  Non-peptide angiotensin II receptor antagonists: synthesis and biological activity of a series of novel 4,5-dihydro-4-oxo-3H-imidazo[4,5-c]pyridine derivatives.,  37  (11): [PMID:8201597] [10.1021/jm00037a014]
2. Sharma MC, Kohli DV.  (2013)  A comprehensive structureactivity analysis 2,3,5-trisubstituted 4,5-dihydro-4-oxo-3H-imidazo [4,5-c] pyridine derivatives as angiotensin II receptor antagonists: using 2D- and 3D-QSAR approach,  22  (2): [10.1007/s00044-012-0040-z]

Source