The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(10R)10-C-(4-O-benzoyl-alpha-arabinopyranosyl)-1,8-dihydroxy-3-methylanthracen-9(10H)-one ID: ALA471183
PubChem CID: 44575608
Max Phase: Preclinical
Molecular Formula: C28H26O8
Molecular Weight: 490.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Picramnioside H | PICRAMNIOSIDE H|CHEMBL471183
Canonical SMILES: Cc1cc(O)c2c(c1)[C@H](C[C@H]1OC[C@@H](OC(=O)c3ccccc3)[C@@H](O)[C@@H]1O)c1cccc(O)c1C2=O
Standard InChI: InChI=1S/C28H26O8/c1-14-10-18-17(16-8-5-9-19(29)23(16)27(33)24(18)20(30)11-14)12-21-25(31)26(32)22(13-35-21)36-28(34)15-6-3-2-4-7-15/h2-11,17,21-22,25-26,29-32H,12-13H2,1H3/t17-,21-,22-,25-,26-/m1/s1
Standard InChI Key: HQLGEJWTJQYJJK-AHVPVAHRSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
9.6861 1.7459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6849 0.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3997 0.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3979 2.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1133 1.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1121 0.9210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8251 0.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8274 2.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5449 1.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5433 0.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2556 0.5106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9701 0.9222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9678 1.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2549 2.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2529 2.9835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6850 0.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8274 2.9900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3955 2.9836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8245 -0.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1097 -0.7289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3979 -0.3185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6853 -0.7270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6804 -1.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3944 -1.9675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1133 -1.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8276 -1.9702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1042 0.1000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.3910 -2.7925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9641 -1.9616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2515 -1.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5351 -1.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2552 -0.7209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8227 -1.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1068 -1.9476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1027 -2.7735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8203 -3.1891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5332 -2.7781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 10 1 0
4 18 1 0
9 8 1 0
7 19 1 6
5 4 2 0
19 20 1 0
20 21 1 0
4 1 1 0
9 10 2 0
5 6 1 0
10 11 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
11 12 2 0
25 26 1 1
2 3 1 0
20 27 1 1
12 13 1 0
24 28 1 6
3 6 2 0
23 29 1 6
13 14 2 0
29 30 1 0
14 9 1 0
30 31 1 0
1 2 2 0
30 32 2 0
14 15 1 0
31 33 2 0
5 8 1 0
33 34 1 0
12 16 1 0
34 35 2 0
6 7 1 0
35 36 1 0
8 17 2 0
36 37 2 0
37 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 490.51Molecular Weight (Monoisotopic): 490.1628AlogP: 2.82#Rotatable Bonds: 4Polar Surface Area: 133.52Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.49CX Basic pKa: ┄CX LogP: 5.19CX LogD: 5.15Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.41Np Likeness Score: 1.40
References 1. Diaz F, Chai HB, Mi Q, Su BN, Vigo JS, Graham JG, Cabieses F, Farnsworth NR, Cordell GA, Pezzuto JM, Swanson SM, Kinghorn AD.. (2004) Anthrone and oxanthrone C-glycosides from Picramnia latifolia collected in Peru., 67 (3): [PMID:15043409 ] [10.1021/np030479j ]