8-chloro-10-dodecylpyrimido[4,5-b]quinoline-2,4(3H,10H)-dione

ID: ALA471341

PubChem CID: 13161691

Max Phase: Preclinical

Molecular Formula: C23H30ClN3O2

Molecular Weight: 415.97

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCn1c2nc(=O)[nH]c(=O)c-2cc2ccc(Cl)cc21

Standard InChI:  InChI=1S/C23H30ClN3O2/c1-2-3-4-5-6-7-8-9-10-11-14-27-20-16-18(24)13-12-17(20)15-19-21(27)25-23(29)26-22(19)28/h12-13,15-16H,2-11,14H2,1H3,(H,26,28,29)

Standard InChI Key:  OYYFRRCJRZALJM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    6.5206    0.5306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2370    0.9440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2341    1.7745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5188    2.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8057    0.9435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8099    1.7709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0994    2.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0911    0.5311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3760    0.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3767    1.7815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6615    2.1951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9411    1.7826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9404    0.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6602    0.5336    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2252    0.5406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6633    3.0201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0881   -0.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8010   -0.7090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5170   -0.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2300   -0.7142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9459   -0.3043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6589   -0.7194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3749   -0.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0878   -0.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8038   -0.3147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5168   -0.7297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2327   -0.3198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9457   -0.7349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9521    0.5326    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
  5  8  1  0
 11 16  2  0
  6  7  1  0
  8 17  1  0
  7 10  2  0
 17 18  1  0
  9  8  1  0
 18 19  1  0
  9 10  1  0
 19 20  1  0
  3  4  2  0
 20 21  1  0
  4  6  1  0
 21 22  1  0
  5  6  2  0
 22 23  1  0
  1  2  2  0
 23 24  1  0
  5  1  1  0
 24 25  1  0
  2  3  1  0
 25 26  1  0
  9 14  2  0
 26 27  1  0
 10 11  1  0
 27 28  1  0
 11 12  1  0
  2 29  1  0
M  END

Alternative Forms

Associated Targets(Human)

KB (17409 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Prkca Protein kinase C (PKC) (359 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 415.97Molecular Weight (Monoisotopic): 415.2027AlogP: 5.76#Rotatable Bonds: 11
Polar Surface Area: 67.75Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.45CX Basic pKa: CX LogP: 6.12CX LogD: 5.16
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.32Np Likeness Score: -0.76

References

1. Ali HI, Tomita K, Akaho E, Kunishima M, Kawashima Y, Yamagishi T, Ikeya H, Nagamatsu T..  (2008)  Antitumor studies -- part 2: structure-activity relationship study for flavin analogs including investigations on their in vitro antitumor assay and docking simulation into protein tyrosine kinase.,  43  (7): [PMID:18055068] [10.1016/j.ejmech.2007.10.011]

Source