The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Piperazinium Pancratistatin 4-O-Phosphate ID: ALA472228
PubChem CID: 49797532
Max Phase: Preclinical
Molecular Formula: C18H26N3O11P
Molecular Weight: 405.25
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Piperazinium Pancratistatin 4-O-Phosphate | CHEMBL472228|Piperazinium Pancratistatin 4-O-Phosphate
Canonical SMILES: C1CNCCN1.O=C1N[C@H]2[C@H](OP(=O)(O)O)[C@H](O)[C@@H](O)[C@H](O)[C@@H]2c2cc3c(c(O)c21)OCO3
Standard InChI: InChI=1S/C14H16NO11P.C4H10N2/c16-8-5-3-1-4-12(25-2-24-4)9(17)6(3)14(20)15-7(5)13(11(19)10(8)18)26-27(21,22)23;1-2-6-4-3-5-1/h1,5,7-8,10-11,13,16-19H,2H2,(H,15,20)(H2,21,22,23);5-6H,1-4H2/t5-,7-,8-,10+,11-,13+;/m1./s1
Standard InChI Key: DVEFZGLWCBLVHL-FKJAIBLQSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
2.8648 -15.3428 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0792 -16.1369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8737 -16.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4556 -15.7599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2375 -14.9634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4375 -14.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2707 -17.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2725 -15.5020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9854 -16.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9888 -15.9177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7737 -15.6661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2554 -16.3350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7683 -16.9997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5572 -15.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5584 -16.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8455 -17.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1270 -16.7414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8432 -15.4956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1300 -15.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4142 -15.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4055 -14.6823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1189 -14.2631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8408 -14.6706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3126 -14.2763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2963 -15.9278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5525 -14.2535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1116 -13.4382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1374 -15.0898 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.8479 -17.9771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2690 -17.9796 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5622 -15.0814 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.0144 -15.5220 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
1.5956 -14.9314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5162 -16.1767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5087 -14.8702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
13 9 1 0
21 24 1 1
14 15 1 0
20 25 1 1
8 10 1 0
23 26 1 1
9 10 2 0
22 27 1 6
19 28 1 1
9 7 1 0
16 29 2 0
14 18 1 0
7 30 1 0
15 16 1 0
18 31 1 6
16 17 1 0
25 32 1 0
17 19 1 0
32 33 1 0
18 19 1 0
32 34 1 0
7 15 2 0
32 35 2 0
14 8 2 0
10 11 1 0
11 12 1 0
12 13 1 0
18 23 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.25Molecular Weight (Monoisotopic): 405.0461AlogP: -2.11#Rotatable Bonds: 2Polar Surface Area: 195.24Molecular Species: ACIDHBA: 9HBD: 7#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.24CX Basic pKa: ┄CX LogP: -2.04CX LogD: -5.58Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.27Np Likeness Score: 2.15
References 1. Pettit GR, Melody N, Herald DL.. (2004) Antineoplastic agents. 511. Direct phosphorylation of phenpanstatin and pancratistatin., 67 (3): [PMID:15043403 ] [10.1021/np030299+ ]