The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-chlorophenyl)-9-(chlorophenylmethylene)-4-(4-methoxyphenyl-amino)-2-methylthio-6,7,8,9-tetrahydropyrimido[4,5-b]quinoline ID: ALA472845
PubChem CID: 44582600
Max Phase: Preclinical
Molecular Formula: C32H28Cl2N4OS
Molecular Weight: 587.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(NC2NC(SC)=Nc3nc4c(c(-c5ccc(Cl)cc5)c32)CCC/C4=C/c2ccc(Cl)cc2)cc1
Standard InChI: InChI=1S/C32H28Cl2N4OS/c1-39-25-16-14-24(15-17-25)35-30-28-27(20-8-12-23(34)13-9-20)26-5-3-4-21(18-19-6-10-22(33)11-7-19)29(26)36-31(28)38-32(37-30)40-2/h6-18,30,35H,3-5H2,1-2H3,(H,36,37,38)/b21-18-
Standard InChI Key: OIQADDAKUUEPPE-UZYVYHOESA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
15.5400 0.5871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9715 -0.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9715 -1.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6913 -1.8863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6913 -0.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4028 -0.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3997 -1.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1145 -1.8873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1124 -0.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8317 -0.6519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8282 -1.4742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5425 -1.8893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2564 -1.4741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2598 -0.6519 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5411 -0.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1144 0.5903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8313 1.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1137 2.2432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4030 1.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8311 1.8287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4016 1.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6911 -2.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4010 -3.1269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4014 -3.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8336 -3.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8352 -3.1242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1136 -4.3665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1169 -2.7140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1132 3.0676 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.5588 -4.3690 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
16.9701 -1.8867 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.9697 -2.7111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2534 1.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9640 0.5864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6770 0.9989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6764 1.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9568 2.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2468 1.8205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3893 2.2384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1044 1.8280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 11 1 0
16 21 1 0
17 20 1 0
20 18 2 0
19 21 2 0
15 1 1 0
4 7 1 0
4 22 2 0
6 5 1 0
22 23 1 0
23 24 2 0
6 7 2 0
25 26 1 0
2 3 1 0
2 5 1 0
10 15 1 0
23 28 1 0
24 27 1 0
27 25 2 0
26 28 2 0
11 12 1 0
18 29 1 0
12 13 2 0
25 30 1 0
13 14 1 0
13 31 1 0
14 15 1 0
31 32 1 0
3 4 1 0
1 33 1 0
9 16 1 0
33 34 2 0
16 17 2 0
34 35 1 0
6 9 1 0
35 36 2 0
18 19 1 0
36 37 1 0
7 8 1 0
37 38 2 0
38 33 1 0
8 11 2 0
36 39 1 0
10 9 2 0
39 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 587.58Molecular Weight (Monoisotopic): 586.1361AlogP: 9.01#Rotatable Bonds: 5Polar Surface Area: 58.54Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.76CX LogP: 9.69CX LogD: 9.69Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.24Np Likeness Score: -0.52
References 1. El-Gazzar AB, Youssef MM, Youssef AM, Abu-Hashem AA, Badria FA.. (2009) Design and synthesis of azolopyrimidoquinolines, pyrimidoquinazolines as anti-oxidant, anti-inflammatory and analgesic activities., 44 (2): [PMID:18462840 ] [10.1016/j.ejmech.2008.03.022 ]