The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-({2-[Tris-(4-methoxyphenyl)methoxy]ethylamino}-methyl)phenol ID: ALA473113
PubChem CID: 25149120
Max Phase: Preclinical
Molecular Formula: C31H33NO5
Molecular Weight: 499.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(OCCNCc2ccccc2O)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1
Standard InChI: InChI=1S/C31H33NO5/c1-34-27-14-8-24(9-15-27)31(25-10-16-28(35-2)17-11-25,26-12-18-29(36-3)19-13-26)37-21-20-32-22-23-6-4-5-7-30(23)33/h4-19,32-33H,20-22H2,1-3H3
Standard InChI Key: ANIYXLFRLIXJHK-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
6.4460 -7.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8585 -7.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6835 -7.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0960 -7.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6835 -8.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8585 -8.4585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6210 -7.7426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4460 -6.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6210 -6.3151 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2085 -5.5992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3835 -5.5992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9710 -4.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1460 -4.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1460 -5.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8618 -6.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8618 -6.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1460 -7.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4301 -6.9458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4301 -6.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1460 -8.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8618 -8.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3210 -4.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9084 -5.5992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0835 -5.5992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6709 -4.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0835 -4.1716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9085 -4.1716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1540 -4.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5665 -4.1716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1460 -4.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4301 -3.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4301 -2.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1460 -2.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8618 -2.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8618 -3.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1460 -1.5833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8618 -1.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
1 7 1 0
10 11 1 0
12 13 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
20 21 1 0
17 20 1 0
13 14 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
28 29 1 0
25 28 1 0
13 22 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
30 35 2 0
36 37 1 0
33 36 1 0
13 30 1 0
11 12 1 0
9 10 1 0
8 9 1 0
2 8 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.61Molecular Weight (Monoisotopic): 499.2359AlogP: 5.52#Rotatable Bonds: 12Polar Surface Area: 69.18Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.28CX Basic pKa: 9.68CX LogP: 4.96CX LogD: 4.18Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.20Np Likeness Score: -0.17
References 1. Kragler A, Höfner G, Wanner KT.. (2008) Synthesis and biological evaluation of aminomethylphenol derivatives as inhibitors of the murine GABA transporters mGAT1-mGAT4., 43 (11): [PMID:18395300 ] [10.1016/j.ejmech.2008.01.005 ]