(3S,4R)-4-(5-Chloro-benzo[d]isoxazol-3-ylamino)-3Shydroxy-2,2-dimethyl-chroman-6-yl-phenyl-methanone

ID: ALA473133

PubChem CID: 44564348

Max Phase: Preclinical

Molecular Formula: C25H21ClN2O4

Molecular Weight: 448.91

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)Oc2ccc(C(=O)c3ccccc3)cc2[C@@H](Nc2noc3ccc(Cl)cc23)[C@@H]1O

Standard InChI:  InChI=1S/C25H21ClN2O4/c1-25(2)23(30)21(27-24-18-13-16(26)9-11-20(18)32-28-24)17-12-15(8-10-19(17)31-25)22(29)14-6-4-3-5-7-14/h3-13,21,23,30H,1-2H3,(H,27,28)/t21-,23+/m1/s1

Standard InChI Key:  YXXXHZMGPOOMLE-GGAORHGYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   10.3541   -7.3015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3530   -8.1290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0679   -8.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0661   -6.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7815   -7.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7803   -8.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4973   -8.5463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2200   -8.1331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2212   -7.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4997   -6.8801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6267   -8.8433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9309   -7.7141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9367   -6.8892    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4933   -6.0521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1647   -5.5726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9467   -5.8348    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4373   -5.1713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1711   -4.7483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9577   -4.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1347   -3.6966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5261   -3.1402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7378   -3.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5645   -4.1961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6395   -6.8892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6393   -6.0641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9251   -7.3019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2105   -6.8878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4966   -7.2998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4963   -8.1258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2160   -8.5379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9270   -8.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1266   -2.8389    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 15 16  2  0
  5  4  2  0
  4  1  1  0
 16 17  1  0
 17 19  1  0
 18 15  1  0
  5 10  1  0
  6  7  1  0
 18 19  2  0
  7  8  1  0
 19 20  1  0
  8  9  1  0
 20 21  2  0
  9 10  1  0
 21 22  1  0
  5  6  1  0
 22 23  2  0
 23 18  1  0
  8 11  1  0
  1 24  1  0
 24 25  2  0
  8 12  1  0
 24 26  1  0
  2  3  1  0
 26 27  2  0
  9 13  1  6
 27 28  1  0
  3  6  2  0
 28 29  2  0
 10 14  1  1
 29 30  1  0
  1  2  2  0
 30 31  2  0
 31 26  1  0
 14 15  1  0
 22 32  1  0
M  END

Associated Targets(Human)

ABCC9 Tclin Sulfonylurea receptor 2 (109 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.91Molecular Weight (Monoisotopic): 448.1190AlogP: 5.40#Rotatable Bonds: 4
Polar Surface Area: 84.59Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.88CX Basic pKa: 0.64CX LogP: 5.01CX LogD: 5.01
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -0.07

References

1. Zhang X, Qiu Y, Li X, Bhattacharjee S, Woods M, Kraft P, Lundeen SG, Sui Z..  (2009)  Discovery and structure-activity relationships of a novel series of benzopyran-based K(ATP) openers for urge urinary incontinence.,  17  (2): [PMID:19101153] [10.1016/j.bmc.2008.11.055]

Source