N-(1-(benzo[d][1,3]dioxol-5-ylmethyl)-5-(piperazine-1-carbonyl)pyrrolidin-3-yl)-N-(3-methoxybenzyl)cyclopropanecarboxamide

ID: ALA473189

PubChem CID: 44565609

Max Phase: Preclinical

Molecular Formula: C29H36N4O5

Molecular Weight: 520.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(CN(C(=O)C2CC2)C2CC(C(=O)N3CCNCC3)N(Cc3ccc4c(c3)OCO4)C2)c1

Standard InChI:  InChI=1S/C29H36N4O5/c1-36-24-4-2-3-20(13-24)17-33(28(34)22-6-7-22)23-15-25(29(35)31-11-9-30-10-12-31)32(18-23)16-21-5-8-26-27(14-21)38-19-37-26/h2-5,8,13-14,22-23,25,30H,6-7,9-12,15-19H2,1H3

Standard InChI Key:  SGJUACHBLJMCQR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   -1.2081   -9.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3878   -9.3864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1440   -8.6006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8138   -8.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4687   -8.6148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5751   -8.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2119   -8.5574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5788   -7.3643    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2943   -6.9511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2979   -6.1276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1274   -6.1225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1321   -6.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1772   -8.1909    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1702   -7.3695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8972   -8.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4540   -6.9608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8852   -6.9497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9027   -9.4245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1918   -9.8430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1952  -10.6665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9172  -11.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6316  -10.6560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6225   -9.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3571  -11.0641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3684  -11.8925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0283  -10.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8594  -10.1035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2751  -10.8183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1003   -9.3945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2753   -9.3930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5097  -10.1082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0966  -10.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6420  -11.4339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3938  -11.1033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3146  -10.2828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2200   -6.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7032   -6.8605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5867   -5.7095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
 11 12  1  0
  5 13  1  0
 13 14  1  0
 13 15  1  0
 14 16  2  0
 14 17  1  0
 15 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 22 24  1  0
 24 25  1  0
  2 26  1  0
  1  2  1  0
 26 27  1  0
  2  3  1  0
 27 28  2  0
 28 32  1  0
  3  4  1  0
 31 29  1  0
  4  5  1  0
 29 30  2  0
 30 27  1  0
 31 32  2  0
  5  1  1  0
  3  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 31  1  0
 36 17  1  0
 37 36  1  0
 17 37  1  0
  8 12  1  0
  9 10  1  0
 38 11  1  0
 10 38  1  0
M  END

Associated Targets(Human)

SHH Tchem Sonic hedgehog protein (71 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 520.63Molecular Weight (Monoisotopic): 520.2686AlogP: 2.24#Rotatable Bonds: 8
Polar Surface Area: 83.58Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.85CX LogP: 1.87CX LogD: 1.24
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.57Np Likeness Score: -1.12

References

1. Mahindroo N, Punchihewa C, Fujii N..  (2009)  Hedgehog-Gli signaling pathway inhibitors as anticancer agents.,  52  (13): [PMID:19309080] [10.1021/jm801420y]

Source