The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(benzo[d][1,3]dioxol-5-ylmethyl)-5-(piperazine-1-carbonyl)pyrrolidin-3-yl)-N-(3-methoxybenzyl)cyclopropanecarboxamide ID: ALA473189
PubChem CID: 44565609
Max Phase: Preclinical
Molecular Formula: C29H36N4O5
Molecular Weight: 520.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(CN(C(=O)C2CC2)C2CC(C(=O)N3CCNCC3)N(Cc3ccc4c(c3)OCO4)C2)c1
Standard InChI: InChI=1S/C29H36N4O5/c1-36-24-4-2-3-20(13-24)17-33(28(34)22-6-7-22)23-15-25(29(35)31-11-9-30-10-12-31)32(18-23)16-21-5-8-26-27(14-21)38-19-37-26/h2-5,8,13-14,22-23,25,30H,6-7,9-12,15-19H2,1H3
Standard InChI Key: SGJUACHBLJMCQR-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
-1.2081 -9.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3878 -9.3864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1440 -8.6006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8138 -8.1247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4687 -8.6148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5751 -8.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2119 -8.5574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5788 -7.3643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2943 -6.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2979 -6.1276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1274 -6.1225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1321 -6.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1772 -8.1909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1702 -7.3695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8972 -8.5974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4540 -6.9608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8852 -6.9497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9027 -9.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1918 -9.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1952 -10.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9172 -11.0766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6316 -10.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6225 -9.8310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3571 -11.0641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3684 -11.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0283 -10.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8594 -10.1035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2751 -10.8183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1003 -9.3945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2753 -9.3930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5097 -10.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0966 -10.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6420 -11.4339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3938 -11.1033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3146 -10.2828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2200 -6.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7032 -6.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5867 -5.7095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11 12 1 0
5 13 1 0
13 14 1 0
13 15 1 0
14 16 2 0
14 17 1 0
15 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 1 0
2 26 1 0
1 2 1 0
26 27 1 0
2 3 1 0
27 28 2 0
28 32 1 0
3 4 1 0
31 29 1 0
4 5 1 0
29 30 2 0
30 27 1 0
31 32 2 0
5 1 1 0
3 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 31 1 0
36 17 1 0
37 36 1 0
17 37 1 0
8 12 1 0
9 10 1 0
38 11 1 0
10 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.63Molecular Weight (Monoisotopic): 520.2686AlogP: 2.24#Rotatable Bonds: 8Polar Surface Area: 83.58Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.85CX LogP: 1.87CX LogD: 1.24Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.57Np Likeness Score: -1.12
References 1. Mahindroo N, Punchihewa C, Fujii N.. (2009) Hedgehog-Gli signaling pathway inhibitors as anticancer agents., 52 (13): [PMID:19309080 ] [10.1021/jm801420y ]