4-((4-Methylpiperazin-1-yl)methyl)-N-(3-(4-(pyridin-3-yl)-1H-imidazol-2-ylamino) phenyl)benzami

ID: ALA473321

PubChem CID: 24971209

Max Phase: Preclinical

Molecular Formula: C27H29N7O

Molecular Weight: 467.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCN(Cc2ccc(C(=O)Nc3cccc(Nc4nc(-c5cccnc5)c[nH]4)c3)cc2)CC1

Standard InChI:  InChI=1S/C27H29N7O/c1-33-12-14-34(15-13-33)19-20-7-9-21(10-8-20)26(35)30-23-5-2-6-24(16-23)31-27-29-18-25(32-27)22-4-3-11-28-17-22/h2-11,16-18H,12-15,19H2,1H3,(H,30,35)(H2,29,31,32)

Standard InChI Key:  KZYJNUNLHGAVQH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -2.4181   -3.8041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4193   -4.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7044   -5.0444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9880   -4.6310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9909   -3.8005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7062   -3.3914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2729   -5.0424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4409   -4.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4396   -3.8038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1341   -5.0434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1347   -5.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8053   -6.3515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5509   -7.1364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7259   -7.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4705   -6.3526    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0327   -7.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8541   -7.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3393   -8.3792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0044   -9.1341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1795   -9.2188    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6979   -8.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1561   -5.0402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1527   -5.8636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8670   -6.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5818   -5.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5778   -5.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8630   -4.6244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2974   -6.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2998   -7.0966    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5833   -7.5057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5837   -8.3271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2975   -8.7414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0126   -8.3281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0139   -7.5005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3000   -9.5634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17 18  1  0
  8  9  2  0
 18 19  2  0
  4  5  1  0
 19 20  1  0
  2 10  1  0
 20 21  2  0
 21 16  1  0
 13 16  1  0
  2  3  1  0
  8 22  1  0
 10 11  1  0
 22 23  2  0
 11 12  2  0
 23 24  1  0
  5  6  2  0
 24 25  2  0
  6  1  1  0
 25 26  1  0
  1  2  2  0
 26 27  2  0
 27 22  1  0
  4  7  1  0
 25 28  1  0
 12 13  1  0
 28 29  1  0
 29 30  1  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
  3  4  2  0
  7  8  1  0
 29 34  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 16 17  2  0
 32 35  1  0
M  END

Associated Targets(non-human)

Pdgfrb Platelet-derived growth factor receptor (285 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 467.58Molecular Weight (Monoisotopic): 467.2434AlogP: 4.22#Rotatable Bonds: 7
Polar Surface Area: 89.18Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.14CX Basic pKa: 8.01CX LogP: 3.67CX LogD: 2.74
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -1.61

References

1. Mahboobi S, Sellmer A, Eswayah A, Elz S, Uecker A, Böhmer FD..  (2008)  Inhibition of PDGFR tyrosine kinase activity by a series of novel N-(3-(4-(pyridin-3-yl)-1H-imidazol-2-ylamino)phenyl)amides: a SAR study on the bioisosterism of pyrimidine and imidazole.,  43  (7): [PMID:17983688] [10.1016/j.ejmech.2007.09.021]

Source